About oxan-4-yl N-(4,4-dimethylcyclohexyl)carbamate
oxan-4-yl N-(4,4-dimethylcyclohexyl)carbamate (PubChem CID 126813583) has the molecular formula C14H25NO3
and a molecular weight of 255.36 g/mol. Its IUPAC name is oxan-4-yl N-(4,4-dimethylcyclohexyl)carbamate.
Molecular Properties
| Compound Name | oxan-4-yl N-(4,4-dimethylcyclohexyl)carbamate |
| PubChem CID | 126813583 |
| Molecular Formula | C14H25NO3 |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.18 |
| IUPAC Name | oxan-4-yl N-(4,4-dimethylcyclohexyl)carbamate |
| SMILES | CC1(C)CCC(NC(=O)OC2CCOCC2)CC1 |
| InChI | InChI=1S/C14H25NO3/c1-14(2)7-3-11(4-8-14)15-13(16)18-12-5-9-17-10-6-12/h11-12H,3-10H2,1-2H3,(H,15,16) |
| InChIKey | YDRXVPRNAIJAKS-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze oxan-4-yl N-(4,4-dimethylcyclohexyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxan-4-yl N-(4,4-dimethylcyclohexyl)carbamate?
The IUPAC name of oxan-4-yl N-(4,4-dimethylcyclohexyl)carbamate (CID 126813583) is oxan-4-yl N-(4,4-dimethylcyclohexyl)carbamate.
What is the SMILES notation for oxan-4-yl N-(4,4-dimethylcyclohexyl)carbamate?
The canonical SMILES for oxan-4-yl N-(4,4-dimethylcyclohexyl)carbamate is CC1(C)CCC(NC(=O)OC2CCOCC2)CC1.
What is the InChIKey of oxan-4-yl N-(4,4-dimethylcyclohexyl)carbamate?
The InChIKey is YDRXVPRNAIJAKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25NO3/c1-14(2)7-3-11(4-8-14)15-13(16)18-12-5-9-17-10-6-12/h11-12H,3-10H2,1-2H3,(H,15,16).
What are the key properties of oxan-4-yl N-(4,4-dimethylcyclohexyl)carbamate?
oxan-4-yl N-(4,4-dimethylcyclohexyl)carbamate has a molecular weight of 255.36 g/mol, XLogP of 2.86, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for oxan-4-yl N-(4,4-dimethylcyclohexyl)carbamate is sourced from PubChem (CID 126813583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).