About N-[1-(2-methoxyethyl)pyrazol-3-yl]-N'-methyl-N'-[(3-methylphenyl)methyl]oxamide
N-[1-(2-methoxyethyl)pyrazol-3-yl]-N'-methyl-N'-[(3-methylphenyl)methyl]oxamide (PubChem CID 126814513) has the molecular formula C17H22N4O3
and a molecular weight of 330.39 g/mol. Its IUPAC name is N-[1-(2-methoxyethyl)pyrazol-3-yl]-N'-methyl-N'-[(3-methylphenyl)methyl]oxamide.
Molecular Properties
| Compound Name | N-[1-(2-methoxyethyl)pyrazol-3-yl]-N'-methyl-N'-[(3-methylphenyl)methyl]oxamide |
| PubChem CID | 126814513 |
| Molecular Formula | C17H22N4O3 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | N-[1-(2-methoxyethyl)pyrazol-3-yl]-N'-methyl-N'-[(3-methylphenyl)methyl]oxamide |
| SMILES | COCCn1ccc(NC(=O)C(=O)N(C)Cc2cccc(C)c2)n1 |
| InChI | InChI=1S/C17H22N4O3/c1-13-5-4-6-14(11-13)12-20(2)17(23)16(22)18-15-7-8-21(19-15)9-10-24-3/h4-8,11H,9-10,12H2,1-3H3,(H,18,19,22) |
| InChIKey | GUPXGUFRXAWQOU-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N-[1-(2-methoxyethyl)pyrazol-3-yl]-N'-methyl-N'-[(3-methylphenyl)methyl]oxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(2-methoxyethyl)pyrazol-3-yl]-N'-methyl-N'-[(3-methylphenyl)methyl]oxamide?
The IUPAC name of N-[1-(2-methoxyethyl)pyrazol-3-yl]-N'-methyl-N'-[(3-methylphenyl)methyl]oxamide (CID 126814513) is N-[1-(2-methoxyethyl)pyrazol-3-yl]-N'-methyl-N'-[(3-methylphenyl)methyl]oxamide.
What is the SMILES notation for N-[1-(2-methoxyethyl)pyrazol-3-yl]-N'-methyl-N'-[(3-methylphenyl)methyl]oxamide?
The canonical SMILES for N-[1-(2-methoxyethyl)pyrazol-3-yl]-N'-methyl-N'-[(3-methylphenyl)methyl]oxamide is COCCn1ccc(NC(=O)C(=O)N(C)Cc2cccc(C)c2)n1.
What is the InChIKey of N-[1-(2-methoxyethyl)pyrazol-3-yl]-N'-methyl-N'-[(3-methylphenyl)methyl]oxamide?
The InChIKey is GUPXGUFRXAWQOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22N4O3/c1-13-5-4-6-14(11-13)12-20(2)17(23)16(22)18-15-7-8-21(19-15)9-10-24-3/h4-8,11H,9-10,12H2,1-3H3,(H,18,19,22).
What are the key properties of N-[1-(2-methoxyethyl)pyrazol-3-yl]-N'-methyl-N'-[(3-methylphenyl)methyl]oxamide?
N-[1-(2-methoxyethyl)pyrazol-3-yl]-N'-methyl-N'-[(3-methylphenyl)methyl]oxamide has a molecular weight of 330.39 g/mol, XLogP of 1.44, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(2-methoxyethyl)pyrazol-3-yl]-N'-methyl-N'-[(3-methylphenyl)methyl]oxamide is sourced from PubChem (CID 126814513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).