C13H20F3NO3 — CID 126814783
(2R,3S)-2-prop-1-en-2-yl-N-(3,3,3-trifluoro-2-hydroxy-2-methylpropyl)oxane-3-carboxamide (PubChem CID 126814783) has the molecular formula C13H20F3NO3 and a molecular weight of 295.30 g/mol. Its IUPAC name is (2R,3S)-2-prop-1-en-2-yl-N-(3,3,3-trifluoro-2-hydroxy-2-methylpropyl)oxane-3-carboxamide.
| Compound Name | (2R,3S)-2-prop-1-en-2-yl-N-(3,3,3-trifluoro-2-hydroxy-2-methylpropyl)oxane-3-carboxamide |
|---|---|
| PubChem CID | 126814783 |
| Molecular Formula | C13H20F3NO3 |
| Molecular Weight | 295.30 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | (2R,3S)-2-prop-1-en-2-yl-N-(3,3,3-trifluoro-2-hydroxy-2-methylpropyl)oxane-3-carboxamide |
| SMILES | C=C(C)[C@@H]1OCCC[C@@H]1C(=O)NCC(C)(O)C(F)(F)F |
| InChI | InChI=1S/C13H20F3NO3/c1-8(2)10-9(5-4-6-20-10)11(18)17-7-12(3,19)13(14,15)16/h9-10,19H,1,4-7H2,2-3H3,(H,17,18)/t9-,10-,12?/m0/s1 |
| InChIKey | MPBMQINGHVRIHG-HVFQMFNGSA-N |
| XLogP | 1.79 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.30 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|