C22H20N4O — CID 126814924
2-[(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)methylidene]-6-methyl-4,9-dihydro-3H-carbazol-1-one (PubChem CID 126814924) has the molecular formula C22H20N4O and a molecular weight of 356.43 g/mol. Its IUPAC name is 2-[(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)methylidene]-6-methyl-4,9-dihydro-3H-carbazol-1-one.
| Compound Name | 2-[(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)methylidene]-6-methyl-4,9-dihydro-3H-carbazol-1-one |
|---|---|
| PubChem CID | 126814924 |
| Molecular Formula | C22H20N4O |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | 2-[(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)methylidene]-6-methyl-4,9-dihydro-3H-carbazol-1-one |
| SMILES | Cc1ccc2[nH]c3c(c2c1)CCC(=Cc1cnc2c(c1)c(C)nn2C)C3=O |
| InChI | InChI=1S/C22H20N4O/c1-12-4-7-19-18(8-12)16-6-5-15(21(27)20(16)24-19)9-14-10-17-13(2)25-26(3)22(17)23-11-14/h4,7-11,24H,5-6H2,1-3H3 |
| InChIKey | GCUYASSAOVTZJS-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|