C17H25N3O2 — CID 126815230
2-[3-(4-ethyl-1,4-diazepan-1-yl)-2-hydroxypropoxy]benzonitrile (PubChem CID 126815230) has the molecular formula C17H25N3O2 and a molecular weight of 303.41 g/mol. Its IUPAC name is 2-[3-(4-ethyl-1,4-diazepan-1-yl)-2-hydroxypropoxy]benzonitrile.
| Compound Name | 2-[3-(4-ethyl-1,4-diazepan-1-yl)-2-hydroxypropoxy]benzonitrile |
|---|---|
| PubChem CID | 126815230 |
| Molecular Formula | C17H25N3O2 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.19 |
| IUPAC Name | 2-[3-(4-ethyl-1,4-diazepan-1-yl)-2-hydroxypropoxy]benzonitrile |
| SMILES | CCN1CCCN(CC(O)COc2ccccc2C#N)CC1 |
| InChI | InChI=1S/C17H25N3O2/c1-2-19-8-5-9-20(11-10-19)13-16(21)14-22-17-7-4-3-6-15(17)12-18/h3-4,6-7,16,21H,2,5,8-11,13-14H2,1H3 |
| InChIKey | RZHRWHALVVMMAU-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 59.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |