About 11-sulfanylidene-10H-phenanthro[9,10-g]pteridin-13-one
11-sulfanylidene-10H-phenanthro[9,10-g]pteridin-13-one (PubChem CID 12681686) has the molecular formula C18H10N4OS
and a molecular weight of 330.37 g/mol. Its IUPAC name is 11-sulfanylidene-10H-phenanthro[9,10-g]pteridin-13-one.
Molecular Properties
| Compound Name | 11-sulfanylidene-10H-phenanthro[9,10-g]pteridin-13-one |
| PubChem CID | 12681686 |
| Molecular Formula | C18H10N4OS |
| Molecular Weight | 330.37 g/mol |
| Exact Mass | 330.06 |
| IUPAC Name | 11-sulfanylidene-10H-phenanthro[9,10-g]pteridin-13-one |
| SMILES | O=c1[nH]c(=S)[nH]c2nc3c4ccccc4c4ccccc4c3nc12 |
| InChI | InChI=1S/C18H10N4OS/c23-17-15-16(21-18(24)22-17)20-14-12-8-4-2-6-10(12)9-5-1-3-7-11(9)13(14)19-15/h1-8H,(H2,20,21,22,23,24) |
| InChIKey | MRLDGQXEPZQWPA-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.37 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 11-sulfanylidene-10H-phenanthro[9,10-g]pteridin-13-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 11-sulfanylidene-10H-phenanthro[9,10-g]pteridin-13-one?
The IUPAC name of 11-sulfanylidene-10H-phenanthro[9,10-g]pteridin-13-one (CID 12681686) is 11-sulfanylidene-10H-phenanthro[9,10-g]pteridin-13-one.
What is the SMILES notation for 11-sulfanylidene-10H-phenanthro[9,10-g]pteridin-13-one?
The canonical SMILES for 11-sulfanylidene-10H-phenanthro[9,10-g]pteridin-13-one is O=c1[nH]c(=S)[nH]c2nc3c4ccccc4c4ccccc4c3nc12.
What is the InChIKey of 11-sulfanylidene-10H-phenanthro[9,10-g]pteridin-13-one?
The InChIKey is MRLDGQXEPZQWPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H10N4OS/c23-17-15-16(21-18(24)22-17)20-14-12-8-4-2-6-10(12)9-5-1-3-7-11(9)13(14)19-15/h1-8H,(H2,20,21,22,23,24).
What are the key properties of 11-sulfanylidene-10H-phenanthro[9,10-g]pteridin-13-one?
11-sulfanylidene-10H-phenanthro[9,10-g]pteridin-13-one has a molecular weight of 330.37 g/mol, XLogP of 3.84, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 11-sulfanylidene-10H-phenanthro[9,10-g]pteridin-13-one is sourced from PubChem (CID 12681686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).