C18H26ClN3O — CID 126817121
[(1R,4S)-4-[[2-chloro-6-(4-methylpiperazin-1-yl)phenyl]methylamino]cyclopent-2-en-1-yl]methanol (PubChem CID 126817121) has the molecular formula C18H26ClN3O and a molecular weight of 335.88 g/mol. Its IUPAC name is [(1R,4S)-4-[[2-chloro-6-(4-methylpiperazin-1-yl)phenyl]methylamino]cyclopent-2-en-1-yl]methanol.
| Compound Name | [(1R,4S)-4-[[2-chloro-6-(4-methylpiperazin-1-yl)phenyl]methylamino]cyclopent-2-en-1-yl]methanol |
|---|---|
| PubChem CID | 126817121 |
| Molecular Formula | C18H26ClN3O |
| Molecular Weight | 335.88 g/mol |
| Exact Mass | 335.18 |
| IUPAC Name | [(1R,4S)-4-[[2-chloro-6-(4-methylpiperazin-1-yl)phenyl]methylamino]cyclopent-2-en-1-yl]methanol |
| SMILES | CN1CCN(c2cccc(Cl)c2CN[C@@H]2C=C[C@H](CO)C2)CC1 |
| InChI | InChI=1S/C18H26ClN3O/c1-21-7-9-22(10-8-21)18-4-2-3-17(19)16(18)12-20-15-6-5-14(11-15)13-23/h2-6,14-15,20,23H,7-13H2,1H3/t14-,15+/m0/s1 |
| InChIKey | RFLHDQWPAUHREX-LSDHHAIUSA-N |
| XLogP | 2.12 |
| TPSA | 38.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.88 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|