C18H32ClN3O2 — CID 126817372
N-[[1-(4,4-dimethylpent-2-enoyl)piperidin-3-yl]methyl]pyrrolidine-2-carboxamide;hydrochloride (PubChem CID 126817372) has the molecular formula C18H32ClN3O2 and a molecular weight of 357.93 g/mol. Its IUPAC name is N-[[1-(4,4-dimethylpent-2-enoyl)piperidin-3-yl]methyl]pyrrolidine-2-carboxamide;hydrochloride.
| Compound Name | N-[[1-(4,4-dimethylpent-2-enoyl)piperidin-3-yl]methyl]pyrrolidine-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 126817372 |
| Molecular Formula | C18H32ClN3O2 |
| Molecular Weight | 357.93 g/mol |
| Exact Mass | 357.22 |
| IUPAC Name | N-[[1-(4,4-dimethylpent-2-enoyl)piperidin-3-yl]methyl]pyrrolidine-2-carboxamide;hydrochloride |
| SMILES | CC(C)(C)C=CC(=O)N1CCCC(CNC(=O)C2CCCN2)C1.Cl |
| InChI | InChI=1S/C18H31N3O2.ClH/c1-18(2,3)9-8-16(22)21-11-5-6-14(13-21)12-20-17(23)15-7-4-10-19-15;/h8-9,14-15,19H,4-7,10-13H2,1-3H3,(H,20,23);1H |
| InChIKey | LJOHCKMCFMQROK-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.93 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|