About 1-ethyl-4-[4-(4-ethyl-2,5-dimethylpiperazin-1-yl)but-2-enyl]-2,5-dimethylpiperazine
1-ethyl-4-[4-(4-ethyl-2,5-dimethylpiperazin-1-yl)but-2-enyl]-2,5-dimethylpiperazine (PubChem CID 126817447) has the molecular formula C20H40N4
and a molecular weight of 336.57 g/mol. Its IUPAC name is 1-ethyl-4-[4-(4-ethyl-2,5-dimethylpiperazin-1-yl)but-2-enyl]-2,5-dimethylpiperazine.
Molecular Properties
| Compound Name | 1-ethyl-4-[4-(4-ethyl-2,5-dimethylpiperazin-1-yl)but-2-enyl]-2,5-dimethylpiperazine |
| PubChem CID | 126817447 |
| Molecular Formula | C20H40N4 |
| Molecular Weight | 336.57 g/mol |
| Exact Mass | 336.33 |
| IUPAC Name | 1-ethyl-4-[4-(4-ethyl-2,5-dimethylpiperazin-1-yl)but-2-enyl]-2,5-dimethylpiperazine |
| SMILES | CCN1CC(C)N(CC=CCN2CC(C)N(CC)CC2C)CC1C |
| InChI | InChI=1S/C20H40N4/c1-7-21-13-19(5)23(15-17(21)3)11-9-10-12-24-16-18(4)22(8-2)14-20(24)6/h9-10,17-20H,7-8,11-16H2,1-6H3 |
| InChIKey | JDRCZTUHLZBKII-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.57 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-4-[4-(4-ethyl-2,5-dimethylpiperazin-1-yl)but-2-enyl]-2,5-dimethylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-4-[4-(4-ethyl-2,5-dimethylpiperazin-1-yl)but-2-enyl]-2,5-dimethylpiperazine?
The IUPAC name of 1-ethyl-4-[4-(4-ethyl-2,5-dimethylpiperazin-1-yl)but-2-enyl]-2,5-dimethylpiperazine (CID 126817447) is 1-ethyl-4-[4-(4-ethyl-2,5-dimethylpiperazin-1-yl)but-2-enyl]-2,5-dimethylpiperazine.
What is the SMILES notation for 1-ethyl-4-[4-(4-ethyl-2,5-dimethylpiperazin-1-yl)but-2-enyl]-2,5-dimethylpiperazine?
The canonical SMILES for 1-ethyl-4-[4-(4-ethyl-2,5-dimethylpiperazin-1-yl)but-2-enyl]-2,5-dimethylpiperazine is CCN1CC(C)N(CC=CCN2CC(C)N(CC)CC2C)CC1C.
What is the InChIKey of 1-ethyl-4-[4-(4-ethyl-2,5-dimethylpiperazin-1-yl)but-2-enyl]-2,5-dimethylpiperazine?
The InChIKey is JDRCZTUHLZBKII-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H40N4/c1-7-21-13-19(5)23(15-17(21)3)11-9-10-12-24-16-18(4)22(8-2)14-20(24)6/h9-10,17-20H,7-8,11-16H2,1-6H3.
What are the key properties of 1-ethyl-4-[4-(4-ethyl-2,5-dimethylpiperazin-1-yl)but-2-enyl]-2,5-dimethylpiperazine?
1-ethyl-4-[4-(4-ethyl-2,5-dimethylpiperazin-1-yl)but-2-enyl]-2,5-dimethylpiperazine has a molecular weight of 336.57 g/mol, XLogP of 2.37, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-4-[4-(4-ethyl-2,5-dimethylpiperazin-1-yl)but-2-enyl]-2,5-dimethylpiperazine is sourced from PubChem (CID 126817447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).