C9H11F4N3 — CID 126818442
1-methyl-4-[(3,3,4,4-tetrafluoropyrrolidin-1-yl)methyl]pyrazole (PubChem CID 126818442) has the molecular formula C9H11F4N3 and a molecular weight of 237.20 g/mol. Its IUPAC name is 1-methyl-4-[(3,3,4,4-tetrafluoropyrrolidin-1-yl)methyl]pyrazole.
| Compound Name | 1-methyl-4-[(3,3,4,4-tetrafluoropyrrolidin-1-yl)methyl]pyrazole |
|---|---|
| PubChem CID | 126818442 |
| Molecular Formula | C9H11F4N3 |
| Molecular Weight | 237.20 g/mol |
| Exact Mass | 237.09 |
| IUPAC Name | 1-methyl-4-[(3,3,4,4-tetrafluoropyrrolidin-1-yl)methyl]pyrazole |
| SMILES | Cn1cc(CN2CC(F)(F)C(F)(F)C2)cn1 |
| InChI | InChI=1S/C9H11F4N3/c1-15-3-7(2-14-15)4-16-5-8(10,11)9(12,13)6-16/h2-3H,4-6H2,1H3 |
| InChIKey | MAVMEJDAOSJOFF-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.20 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|