About N-(3-hydroxy-3-methylcyclobutyl)-5-methyl-1,2-thiazole-3-carboxamide
N-(3-hydroxy-3-methylcyclobutyl)-5-methyl-1,2-thiazole-3-carboxamide (PubChem CID 126819050) has the molecular formula C10H14N2O2S
and a molecular weight of 226.30 g/mol. Its IUPAC name is N-(3-hydroxy-3-methylcyclobutyl)-5-methyl-1,2-thiazole-3-carboxamide.
Molecular Properties
| Compound Name | N-(3-hydroxy-3-methylcyclobutyl)-5-methyl-1,2-thiazole-3-carboxamide |
| PubChem CID | 126819050 |
| Molecular Formula | C10H14N2O2S |
| Molecular Weight | 226.30 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | N-(3-hydroxy-3-methylcyclobutyl)-5-methyl-1,2-thiazole-3-carboxamide |
| SMILES | Cc1cc(C(=O)NC2CC(C)(O)C2)ns1 |
| InChI | InChI=1S/C10H14N2O2S/c1-6-3-8(12-15-6)9(13)11-7-4-10(2,14)5-7/h3,7,14H,4-5H2,1-2H3,(H,11,13) |
| InChIKey | AZQOMVZUKMTMSS-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.30 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(3-hydroxy-3-methylcyclobutyl)-5-methyl-1,2-thiazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-hydroxy-3-methylcyclobutyl)-5-methyl-1,2-thiazole-3-carboxamide?
The IUPAC name of N-(3-hydroxy-3-methylcyclobutyl)-5-methyl-1,2-thiazole-3-carboxamide (CID 126819050) is N-(3-hydroxy-3-methylcyclobutyl)-5-methyl-1,2-thiazole-3-carboxamide.
What is the SMILES notation for N-(3-hydroxy-3-methylcyclobutyl)-5-methyl-1,2-thiazole-3-carboxamide?
The canonical SMILES for N-(3-hydroxy-3-methylcyclobutyl)-5-methyl-1,2-thiazole-3-carboxamide is Cc1cc(C(=O)NC2CC(C)(O)C2)ns1.
What is the InChIKey of N-(3-hydroxy-3-methylcyclobutyl)-5-methyl-1,2-thiazole-3-carboxamide?
The InChIKey is AZQOMVZUKMTMSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2O2S/c1-6-3-8(12-15-6)9(13)11-7-4-10(2,14)5-7/h3,7,14H,4-5H2,1-2H3,(H,11,13).
What are the key properties of N-(3-hydroxy-3-methylcyclobutyl)-5-methyl-1,2-thiazole-3-carboxamide?
N-(3-hydroxy-3-methylcyclobutyl)-5-methyl-1,2-thiazole-3-carboxamide has a molecular weight of 226.30 g/mol, XLogP of 1.09, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-hydroxy-3-methylcyclobutyl)-5-methyl-1,2-thiazole-3-carboxamide is sourced from PubChem (CID 126819050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).