About [3-(2,2-difluoroethyl)azetidin-1-yl]-(5-methyl-1,2-thiazol-3-yl)methanone
[3-(2,2-difluoroethyl)azetidin-1-yl]-(5-methyl-1,2-thiazol-3-yl)methanone (PubChem CID 126819354) has the molecular formula C10H12F2N2OS
and a molecular weight of 246.28 g/mol. Its IUPAC name is [3-(2,2-difluoroethyl)azetidin-1-yl]-(5-methyl-1,2-thiazol-3-yl)methanone.
Molecular Properties
| Compound Name | [3-(2,2-difluoroethyl)azetidin-1-yl]-(5-methyl-1,2-thiazol-3-yl)methanone |
| PubChem CID | 126819354 |
| Molecular Formula | C10H12F2N2OS |
| Molecular Weight | 246.28 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | [3-(2,2-difluoroethyl)azetidin-1-yl]-(5-methyl-1,2-thiazol-3-yl)methanone |
| SMILES | Cc1cc(C(=O)N2CC(CC(F)F)C2)ns1 |
| InChI | InChI=1S/C10H12F2N2OS/c1-6-2-8(13-16-6)10(15)14-4-7(5-14)3-9(11)12/h2,7,9H,3-5H2,1H3 |
| InChIKey | YPKBCQIFJRUYNX-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.28 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [3-(2,2-difluoroethyl)azetidin-1-yl]-(5-methyl-1,2-thiazol-3-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(2,2-difluoroethyl)azetidin-1-yl]-(5-methyl-1,2-thiazol-3-yl)methanone?
The IUPAC name of [3-(2,2-difluoroethyl)azetidin-1-yl]-(5-methyl-1,2-thiazol-3-yl)methanone (CID 126819354) is [3-(2,2-difluoroethyl)azetidin-1-yl]-(5-methyl-1,2-thiazol-3-yl)methanone.
What is the SMILES notation for [3-(2,2-difluoroethyl)azetidin-1-yl]-(5-methyl-1,2-thiazol-3-yl)methanone?
The canonical SMILES for [3-(2,2-difluoroethyl)azetidin-1-yl]-(5-methyl-1,2-thiazol-3-yl)methanone is Cc1cc(C(=O)N2CC(CC(F)F)C2)ns1.
What is the InChIKey of [3-(2,2-difluoroethyl)azetidin-1-yl]-(5-methyl-1,2-thiazol-3-yl)methanone?
The InChIKey is YPKBCQIFJRUYNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12F2N2OS/c1-6-2-8(13-16-6)10(15)14-4-7(5-14)3-9(11)12/h2,7,9H,3-5H2,1H3.
What are the key properties of [3-(2,2-difluoroethyl)azetidin-1-yl]-(5-methyl-1,2-thiazol-3-yl)methanone?
[3-(2,2-difluoroethyl)azetidin-1-yl]-(5-methyl-1,2-thiazol-3-yl)methanone has a molecular weight of 246.28 g/mol, XLogP of 2.18, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(2,2-difluoroethyl)azetidin-1-yl]-(5-methyl-1,2-thiazol-3-yl)methanone is sourced from PubChem (CID 126819354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).