C17H15F3N4O3 — CID 126819630
1-ethyl-4-[[6-(2,2,2-trifluoroethoxy)pyridazin-3-yl]methyl]quinoxaline-2,3-dione (PubChem CID 126819630) has the molecular formula C17H15F3N4O3 and a molecular weight of 380.33 g/mol. Its IUPAC name is 1-ethyl-4-[[6-(2,2,2-trifluoroethoxy)pyridazin-3-yl]methyl]quinoxaline-2,3-dione.
| Compound Name | 1-ethyl-4-[[6-(2,2,2-trifluoroethoxy)pyridazin-3-yl]methyl]quinoxaline-2,3-dione |
|---|---|
| PubChem CID | 126819630 |
| Molecular Formula | C17H15F3N4O3 |
| Molecular Weight | 380.33 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | 1-ethyl-4-[[6-(2,2,2-trifluoroethoxy)pyridazin-3-yl]methyl]quinoxaline-2,3-dione |
| SMILES | CCn1c(=O)c(=O)n(Cc2ccc(OCC(F)(F)F)nn2)c2ccccc21 |
| InChI | InChI=1S/C17H15F3N4O3/c1-2-23-12-5-3-4-6-13(12)24(16(26)15(23)25)9-11-7-8-14(22-21-11)27-10-17(18,19)20/h3-8H,2,9-10H2,1H3 |
| InChIKey | RLJXNRPWNCFFFE-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 79.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.33 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|