C16H21FN2O2 — CID 126819981
1-[4-(3-fluorophenyl)-3-methylbutanoyl]-3-methylazetidine-3-carboxamide (PubChem CID 126819981) has the molecular formula C16H21FN2O2 and a molecular weight of 292.35 g/mol. Its IUPAC name is 1-[4-(3-fluorophenyl)-3-methylbutanoyl]-3-methylazetidine-3-carboxamide.
| Compound Name | 1-[4-(3-fluorophenyl)-3-methylbutanoyl]-3-methylazetidine-3-carboxamide |
|---|---|
| PubChem CID | 126819981 |
| Molecular Formula | C16H21FN2O2 |
| Molecular Weight | 292.35 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | 1-[4-(3-fluorophenyl)-3-methylbutanoyl]-3-methylazetidine-3-carboxamide |
| SMILES | CC(CC(=O)N1CC(C)(C(N)=O)C1)Cc1cccc(F)c1 |
| InChI | InChI=1S/C16H21FN2O2/c1-11(6-12-4-3-5-13(17)8-12)7-14(20)19-9-16(2,10-19)15(18)21/h3-5,8,11H,6-7,9-10H2,1-2H3,(H2,18,21) |
| InChIKey | CWUJOXYKQUMWKC-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.35 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |