About 2-(3,5-dimethyl-1H-pyrazol-4-yl)-N-[3-hydroxy-3-(trifluoromethyl)cyclobutyl]acetamide
2-(3,5-dimethyl-1H-pyrazol-4-yl)-N-[3-hydroxy-3-(trifluoromethyl)cyclobutyl]acetamide (PubChem CID 126820302) has the molecular formula C12H16F3N3O2
and a molecular weight of 291.27 g/mol. Its IUPAC name is 2-(3,5-dimethyl-1H-pyrazol-4-yl)-N-[3-hydroxy-3-(trifluoromethyl)cyclobutyl]acetamide.
Molecular Properties
| Compound Name | 2-(3,5-dimethyl-1H-pyrazol-4-yl)-N-[3-hydroxy-3-(trifluoromethyl)cyclobutyl]acetamide |
| PubChem CID | 126820302 |
| Molecular Formula | C12H16F3N3O2 |
| Molecular Weight | 291.27 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | 2-(3,5-dimethyl-1H-pyrazol-4-yl)-N-[3-hydroxy-3-(trifluoromethyl)cyclobutyl]acetamide |
| SMILES | Cc1n[nH]c(C)c1CC(=O)NC1CC(O)(C(F)(F)F)C1 |
| InChI | InChI=1S/C12H16F3N3O2/c1-6-9(7(2)18-17-6)3-10(19)16-8-4-11(20,5-8)12(13,14)15/h8,20H,3-5H2,1-2H3,(H,16,19)(H,17,18) |
| InChIKey | KSGMRKNEBHEFKK-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.27 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(3,5-dimethyl-1H-pyrazol-4-yl)-N-[3-hydroxy-3-(trifluoromethyl)cyclobutyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,5-dimethyl-1H-pyrazol-4-yl)-N-[3-hydroxy-3-(trifluoromethyl)cyclobutyl]acetamide?
The IUPAC name of 2-(3,5-dimethyl-1H-pyrazol-4-yl)-N-[3-hydroxy-3-(trifluoromethyl)cyclobutyl]acetamide (CID 126820302) is 2-(3,5-dimethyl-1H-pyrazol-4-yl)-N-[3-hydroxy-3-(trifluoromethyl)cyclobutyl]acetamide.
What is the SMILES notation for 2-(3,5-dimethyl-1H-pyrazol-4-yl)-N-[3-hydroxy-3-(trifluoromethyl)cyclobutyl]acetamide?
The canonical SMILES for 2-(3,5-dimethyl-1H-pyrazol-4-yl)-N-[3-hydroxy-3-(trifluoromethyl)cyclobutyl]acetamide is Cc1n[nH]c(C)c1CC(=O)NC1CC(O)(C(F)(F)F)C1.
What is the InChIKey of 2-(3,5-dimethyl-1H-pyrazol-4-yl)-N-[3-hydroxy-3-(trifluoromethyl)cyclobutyl]acetamide?
The InChIKey is KSGMRKNEBHEFKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16F3N3O2/c1-6-9(7(2)18-17-6)3-10(19)16-8-4-11(20,5-8)12(13,14)15/h8,20H,3-5H2,1-2H3,(H,16,19)(H,17,18).
What are the key properties of 2-(3,5-dimethyl-1H-pyrazol-4-yl)-N-[3-hydroxy-3-(trifluoromethyl)cyclobutyl]acetamide?
2-(3,5-dimethyl-1H-pyrazol-4-yl)-N-[3-hydroxy-3-(trifluoromethyl)cyclobutyl]acetamide has a molecular weight of 291.27 g/mol, XLogP of 1.14, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,5-dimethyl-1H-pyrazol-4-yl)-N-[3-hydroxy-3-(trifluoromethyl)cyclobutyl]acetamide is sourced from PubChem (CID 126820302), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).