About 3-[[dimethyl(oxo)-λ6-sulfanylidene]amino]-N-[(2-methylfuran-3-yl)methyl]aniline
3-[[dimethyl(oxo)-λ6-sulfanylidene]amino]-N-[(2-methylfuran-3-yl)methyl]aniline (PubChem CID 126820490) has the molecular formula C14H18N2O2S
and a molecular weight of 278.38 g/mol. Its IUPAC name is 3-[[dimethyl(oxo)-λ6-sulfanylidene]amino]-N-[(2-methylfuran-3-yl)methyl]aniline.
Molecular Properties
| Compound Name | 3-[[dimethyl(oxo)-λ6-sulfanylidene]amino]-N-[(2-methylfuran-3-yl)methyl]aniline |
| PubChem CID | 126820490 |
| Molecular Formula | C14H18N2O2S |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | 3-[[dimethyl(oxo)-λ6-sulfanylidene]amino]-N-[(2-methylfuran-3-yl)methyl]aniline |
| SMILES | Cc1occc1CNc1cccc(N=S(C)(C)=O)c1 |
| InChI | InChI=1S/C14H18N2O2S/c1-11-12(7-8-18-11)10-15-13-5-4-6-14(9-13)16-19(2,3)17/h4-9,15H,10H2,1-3H3 |
| InChIKey | VKGNPQOYUJPXBI-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[[dimethyl(oxo)-λ6-sulfanylidene]amino]-N-[(2-methylfuran-3-yl)methyl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[dimethyl(oxo)-λ6-sulfanylidene]amino]-N-[(2-methylfuran-3-yl)methyl]aniline?
The IUPAC name of 3-[[dimethyl(oxo)-λ6-sulfanylidene]amino]-N-[(2-methylfuran-3-yl)methyl]aniline (CID 126820490) is 3-[[dimethyl(oxo)-λ6-sulfanylidene]amino]-N-[(2-methylfuran-3-yl)methyl]aniline.
What is the SMILES notation for 3-[[dimethyl(oxo)-λ6-sulfanylidene]amino]-N-[(2-methylfuran-3-yl)methyl]aniline?
The canonical SMILES for 3-[[dimethyl(oxo)-λ6-sulfanylidene]amino]-N-[(2-methylfuran-3-yl)methyl]aniline is Cc1occc1CNc1cccc(N=S(C)(C)=O)c1.
What is the InChIKey of 3-[[dimethyl(oxo)-λ6-sulfanylidene]amino]-N-[(2-methylfuran-3-yl)methyl]aniline?
The InChIKey is VKGNPQOYUJPXBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N2O2S/c1-11-12(7-8-18-11)10-15-13-5-4-6-14(9-13)16-19(2,3)17/h4-9,15H,10H2,1-3H3.
What are the key properties of 3-[[dimethyl(oxo)-λ6-sulfanylidene]amino]-N-[(2-methylfuran-3-yl)methyl]aniline?
3-[[dimethyl(oxo)-λ6-sulfanylidene]amino]-N-[(2-methylfuran-3-yl)methyl]aniline has a molecular weight of 278.38 g/mol, XLogP of 3.56, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[dimethyl(oxo)-λ6-sulfanylidene]amino]-N-[(2-methylfuran-3-yl)methyl]aniline is sourced from PubChem (CID 126820490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).