C20H25N3O — CID 126820564
(4-methylazepan-1-yl)-[3-(pyridin-2-ylmethylamino)phenyl]methanone (PubChem CID 126820564) has the molecular formula C20H25N3O and a molecular weight of 323.44 g/mol. Its IUPAC name is (4-methylazepan-1-yl)-[3-(pyridin-2-ylmethylamino)phenyl]methanone.
| Compound Name | (4-methylazepan-1-yl)-[3-(pyridin-2-ylmethylamino)phenyl]methanone |
|---|---|
| PubChem CID | 126820564 |
| Molecular Formula | C20H25N3O |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.20 |
| IUPAC Name | (4-methylazepan-1-yl)-[3-(pyridin-2-ylmethylamino)phenyl]methanone |
| SMILES | CC1CCCN(C(=O)c2cccc(NCc3ccccn3)c2)CC1 |
| InChI | InChI=1S/C20H25N3O/c1-16-6-5-12-23(13-10-16)20(24)17-7-4-9-18(14-17)22-15-19-8-2-3-11-21-19/h2-4,7-9,11,14,16,22H,5-6,10,12-13,15H2,1H3 |
| InChIKey | OYUUHJLZEITYSE-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |