About 3-[4-(2,3-difluorophenyl)-1,4-diazepan-1-yl]-1-methylpyrazin-2-one
3-[4-(2,3-difluorophenyl)-1,4-diazepan-1-yl]-1-methylpyrazin-2-one (PubChem CID 126821665) has the molecular formula C16H18F2N4O
and a molecular weight of 320.34 g/mol. Its IUPAC name is 3-[4-(2,3-difluorophenyl)-1,4-diazepan-1-yl]-1-methylpyrazin-2-one.
Molecular Properties
| Compound Name | 3-[4-(2,3-difluorophenyl)-1,4-diazepan-1-yl]-1-methylpyrazin-2-one |
| PubChem CID | 126821665 |
| Molecular Formula | C16H18F2N4O |
| Molecular Weight | 320.34 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | 3-[4-(2,3-difluorophenyl)-1,4-diazepan-1-yl]-1-methylpyrazin-2-one |
| SMILES | Cn1ccnc(N2CCCN(c3cccc(F)c3F)CC2)c1=O |
| InChI | InChI=1S/C16H18F2N4O/c1-20-9-6-19-15(16(20)23)22-8-3-7-21(10-11-22)13-5-2-4-12(17)14(13)18/h2,4-6,9H,3,7-8,10-11H2,1H3 |
| InChIKey | FLKAFKWWMAIOGI-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.34 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[4-(2,3-difluorophenyl)-1,4-diazepan-1-yl]-1-methylpyrazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-(2,3-difluorophenyl)-1,4-diazepan-1-yl]-1-methylpyrazin-2-one?
The IUPAC name of 3-[4-(2,3-difluorophenyl)-1,4-diazepan-1-yl]-1-methylpyrazin-2-one (CID 126821665) is 3-[4-(2,3-difluorophenyl)-1,4-diazepan-1-yl]-1-methylpyrazin-2-one.
What is the SMILES notation for 3-[4-(2,3-difluorophenyl)-1,4-diazepan-1-yl]-1-methylpyrazin-2-one?
The canonical SMILES for 3-[4-(2,3-difluorophenyl)-1,4-diazepan-1-yl]-1-methylpyrazin-2-one is Cn1ccnc(N2CCCN(c3cccc(F)c3F)CC2)c1=O.
What is the InChIKey of 3-[4-(2,3-difluorophenyl)-1,4-diazepan-1-yl]-1-methylpyrazin-2-one?
The InChIKey is FLKAFKWWMAIOGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18F2N4O/c1-20-9-6-19-15(16(20)23)22-8-3-7-21(10-11-22)13-5-2-4-12(17)14(13)18/h2,4-6,9H,3,7-8,10-11H2,1H3.
What are the key properties of 3-[4-(2,3-difluorophenyl)-1,4-diazepan-1-yl]-1-methylpyrazin-2-one?
3-[4-(2,3-difluorophenyl)-1,4-diazepan-1-yl]-1-methylpyrazin-2-one has a molecular weight of 320.34 g/mol, XLogP of 1.78, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-(2,3-difluorophenyl)-1,4-diazepan-1-yl]-1-methylpyrazin-2-one is sourced from PubChem (CID 126821665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).