About (2R,3S)-3-hydroxy-N,N-dimethyl-2-prop-1-en-2-ylhexanamide
(2R,3S)-3-hydroxy-N,N-dimethyl-2-prop-1-en-2-ylhexanamide (PubChem CID 12682173) has the molecular formula C11H21NO2
and a molecular weight of 199.29 g/mol. Its IUPAC name is (2R,3S)-3-hydroxy-N,N-dimethyl-2-prop-1-en-2-ylhexanamide.
Molecular Properties
| Compound Name | (2R,3S)-3-hydroxy-N,N-dimethyl-2-prop-1-en-2-ylhexanamide |
| PubChem CID | 12682173 |
| Molecular Formula | C11H21NO2 |
| Molecular Weight | 199.29 g/mol |
| Exact Mass | 199.16 |
| IUPAC Name | (2R,3S)-3-hydroxy-N,N-dimethyl-2-prop-1-en-2-ylhexanamide |
| SMILES | C=C(C)[C@@H](C(=O)N(C)C)[C@@H](O)CCC |
| InChI | InChI=1S/C11H21NO2/c1-6-7-9(13)10(8(2)3)11(14)12(4)5/h9-10,13H,2,6-7H2,1,3-5H3/t9-,10+/m0/s1 |
| InChIKey | WHTDIJRMZHQIKZ-VHSXEESVSA-N |
| XLogP | 1.43 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.29 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2R,3S)-3-hydroxy-N,N-dimethyl-2-prop-1-en-2-ylhexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,3S)-3-hydroxy-N,N-dimethyl-2-prop-1-en-2-ylhexanamide?
The IUPAC name of (2R,3S)-3-hydroxy-N,N-dimethyl-2-prop-1-en-2-ylhexanamide (CID 12682173) is (2R,3S)-3-hydroxy-N,N-dimethyl-2-prop-1-en-2-ylhexanamide.
What is the SMILES notation for (2R,3S)-3-hydroxy-N,N-dimethyl-2-prop-1-en-2-ylhexanamide?
The canonical SMILES for (2R,3S)-3-hydroxy-N,N-dimethyl-2-prop-1-en-2-ylhexanamide is C=C(C)[C@@H](C(=O)N(C)C)[C@@H](O)CCC.
What is the InChIKey of (2R,3S)-3-hydroxy-N,N-dimethyl-2-prop-1-en-2-ylhexanamide?
The InChIKey is WHTDIJRMZHQIKZ-VHSXEESVSA-N. The full InChI is InChI=1S/C11H21NO2/c1-6-7-9(13)10(8(2)3)11(14)12(4)5/h9-10,13H,2,6-7H2,1,3-5H3/t9-,10+/m0/s1.
What are the key properties of (2R,3S)-3-hydroxy-N,N-dimethyl-2-prop-1-en-2-ylhexanamide?
(2R,3S)-3-hydroxy-N,N-dimethyl-2-prop-1-en-2-ylhexanamide has a molecular weight of 199.29 g/mol, XLogP of 1.43, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,3S)-3-hydroxy-N,N-dimethyl-2-prop-1-en-2-ylhexanamide is sourced from PubChem (CID 12682173), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).