C15H19BN2O4 — CID 126822123
4-(1-hydroxy-3H-2,1-benzoxaborole-6-carbonyl)-1,3,3-trimethylpiperazin-2-one (PubChem CID 126822123) has the molecular formula C15H19BN2O4 and a molecular weight of 302.14 g/mol. Its IUPAC name is 4-(1-hydroxy-3H-2,1-benzoxaborole-6-carbonyl)-1,3,3-trimethylpiperazin-2-one.
| Compound Name | 4-(1-hydroxy-3H-2,1-benzoxaborole-6-carbonyl)-1,3,3-trimethylpiperazin-2-one |
|---|---|
| PubChem CID | 126822123 |
| Molecular Formula | C15H19BN2O4 |
| Molecular Weight | 302.14 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | 4-(1-hydroxy-3H-2,1-benzoxaborole-6-carbonyl)-1,3,3-trimethylpiperazin-2-one |
| SMILES | CN1CCN(C(=O)c2ccc3c(c2)B(O)OC3)C(C)(C)C1=O |
| InChI | InChI=1S/C15H19BN2O4/c1-15(2)14(20)17(3)6-7-18(15)13(19)10-4-5-11-9-22-16(21)12(11)8-10/h4-5,8,21H,6-7,9H2,1-3H3 |
| InChIKey | BRKQWWXXHOEPIY-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.14 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|