C18H21FN6O2 — CID 126822365
1-[bis(1-methylimidazol-2-yl)methyl]-3-(5-fluoro-4-methoxy-2-methylphenyl)urea (PubChem CID 126822365) has the molecular formula C18H21FN6O2 and a molecular weight of 372.40 g/mol. Its IUPAC name is 1-[bis(1-methylimidazol-2-yl)methyl]-3-(5-fluoro-4-methoxy-2-methylphenyl)urea.
| Compound Name | 1-[bis(1-methylimidazol-2-yl)methyl]-3-(5-fluoro-4-methoxy-2-methylphenyl)urea |
|---|---|
| PubChem CID | 126822365 |
| Molecular Formula | C18H21FN6O2 |
| Molecular Weight | 372.40 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | 1-[bis(1-methylimidazol-2-yl)methyl]-3-(5-fluoro-4-methoxy-2-methylphenyl)urea |
| SMILES | COc1cc(C)c(NC(=O)NC(c2nccn2C)c2nccn2C)cc1F |
| InChI | InChI=1S/C18H21FN6O2/c1-11-9-14(27-4)12(19)10-13(11)22-18(26)23-15(16-20-5-7-24(16)2)17-21-6-8-25(17)3/h5-10,15H,1-4H3,(H2,22,23,26) |
| InChIKey | HBWFDNQXDBEIPI-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 86.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.40 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |