About 1-ethyl-N-(5-hydroxy-2,2-dimethylpentyl)-5-oxopyrrolidine-3-sulfonamide
1-ethyl-N-(5-hydroxy-2,2-dimethylpentyl)-5-oxopyrrolidine-3-sulfonamide (PubChem CID 126823047) has the molecular formula C13H26N2O4S
and a molecular weight of 306.43 g/mol. Its IUPAC name is 1-ethyl-N-(5-hydroxy-2,2-dimethylpentyl)-5-oxopyrrolidine-3-sulfonamide.
Molecular Properties
| Compound Name | 1-ethyl-N-(5-hydroxy-2,2-dimethylpentyl)-5-oxopyrrolidine-3-sulfonamide |
| PubChem CID | 126823047 |
| Molecular Formula | C13H26N2O4S |
| Molecular Weight | 306.43 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | 1-ethyl-N-(5-hydroxy-2,2-dimethylpentyl)-5-oxopyrrolidine-3-sulfonamide |
| SMILES | CCN1CC(S(=O)(=O)NCC(C)(C)CCCO)CC1=O |
| InChI | InChI=1S/C13H26N2O4S/c1-4-15-9-11(8-12(15)17)20(18,19)14-10-13(2,3)6-5-7-16/h11,14,16H,4-10H2,1-3H3 |
| InChIKey | NEIUISHBLLHQOB-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.43 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-ethyl-N-(5-hydroxy-2,2-dimethylpentyl)-5-oxopyrrolidine-3-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-N-(5-hydroxy-2,2-dimethylpentyl)-5-oxopyrrolidine-3-sulfonamide?
The IUPAC name of 1-ethyl-N-(5-hydroxy-2,2-dimethylpentyl)-5-oxopyrrolidine-3-sulfonamide (CID 126823047) is 1-ethyl-N-(5-hydroxy-2,2-dimethylpentyl)-5-oxopyrrolidine-3-sulfonamide.
What is the SMILES notation for 1-ethyl-N-(5-hydroxy-2,2-dimethylpentyl)-5-oxopyrrolidine-3-sulfonamide?
The canonical SMILES for 1-ethyl-N-(5-hydroxy-2,2-dimethylpentyl)-5-oxopyrrolidine-3-sulfonamide is CCN1CC(S(=O)(=O)NCC(C)(C)CCCO)CC1=O.
What is the InChIKey of 1-ethyl-N-(5-hydroxy-2,2-dimethylpentyl)-5-oxopyrrolidine-3-sulfonamide?
The InChIKey is NEIUISHBLLHQOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26N2O4S/c1-4-15-9-11(8-12(15)17)20(18,19)14-10-13(2,3)6-5-7-16/h11,14,16H,4-10H2,1-3H3.
What are the key properties of 1-ethyl-N-(5-hydroxy-2,2-dimethylpentyl)-5-oxopyrrolidine-3-sulfonamide?
1-ethyl-N-(5-hydroxy-2,2-dimethylpentyl)-5-oxopyrrolidine-3-sulfonamide has a molecular weight of 306.43 g/mol, XLogP of 0.33, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-N-(5-hydroxy-2,2-dimethylpentyl)-5-oxopyrrolidine-3-sulfonamide is sourced from PubChem (CID 126823047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).