C12H17NO5S2 — CID 126823202
2-ethyl-N-[(3S,4S)-4-hydroxy-1,1-dioxothiolan-3-yl]benzenesulfonamide (PubChem CID 126823202) has the molecular formula C12H17NO5S2 and a molecular weight of 319.40 g/mol. Its IUPAC name is 2-ethyl-N-[(3S,4S)-4-hydroxy-1,1-dioxothiolan-3-yl]benzenesulfonamide.
| Compound Name | 2-ethyl-N-[(3S,4S)-4-hydroxy-1,1-dioxothiolan-3-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 126823202 |
| Molecular Formula | C12H17NO5S2 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.05 |
| IUPAC Name | 2-ethyl-N-[(3S,4S)-4-hydroxy-1,1-dioxothiolan-3-yl]benzenesulfonamide |
| SMILES | CCc1ccccc1S(=O)(=O)N[C@@H]1CS(=O)(=O)C[C@H]1O |
| InChI | InChI=1S/C12H17NO5S2/c1-2-9-5-3-4-6-12(9)20(17,18)13-10-7-19(15,16)8-11(10)14/h3-6,10-11,13-14H,2,7-8H2,1H3/t10-,11-/m1/s1 |
| InChIKey | QUEOPRWDTAHBBU-GHMZBOCLSA-N |
| XLogP | -0.31 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |