C14H19N3OS — CID 126823787
2-[(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)methylamino]hex-4-yn-1-ol (PubChem CID 126823787) has the molecular formula C14H19N3OS and a molecular weight of 277.39 g/mol. Its IUPAC name is 2-[(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)methylamino]hex-4-yn-1-ol.
| Compound Name | 2-[(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)methylamino]hex-4-yn-1-ol |
|---|---|
| PubChem CID | 126823787 |
| Molecular Formula | C14H19N3OS |
| Molecular Weight | 277.39 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | 2-[(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)methylamino]hex-4-yn-1-ol |
| SMILES | CC#CCC(CO)NCc1c(C)nc2sc(C)cn12 |
| InChI | InChI=1S/C14H19N3OS/c1-4-5-6-12(9-18)15-7-13-11(3)16-14-17(13)8-10(2)19-14/h8,12,15,18H,6-7,9H2,1-3H3 |
| InChIKey | LPRVXMXBNXQAAF-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 49.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.39 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|