About [1,3]dioxolo[4,5-c]pyridin-6-ylmethanamine;dihydrochloride
[1,3]dioxolo[4,5-c]pyridin-6-ylmethanamine;dihydrochloride (PubChem CID 126824914) has the molecular formula C7H10Cl2N2O2
and a molecular weight of 225.07 g/mol. Its IUPAC name is [1,3]dioxolo[4,5-c]pyridin-6-ylmethanamine;dihydrochloride.
Molecular Properties
| Compound Name | [1,3]dioxolo[4,5-c]pyridin-6-ylmethanamine;dihydrochloride |
| PubChem CID | 126824914 |
| Molecular Formula | C7H10Cl2N2O2 |
| Molecular Weight | 225.07 g/mol |
| Exact Mass | 224.01 |
| IUPAC Name | [1,3]dioxolo[4,5-c]pyridin-6-ylmethanamine;dihydrochloride |
| SMILES | Cl.Cl.NCc1cc2c(cn1)OCO2 |
| InChI | InChI=1S/C7H8N2O2.2ClH/c8-2-5-1-6-7(3-9-5)11-4-10-6;;/h1,3H,2,4,8H2;2*1H |
| InChIKey | JKLUWXRLLBBYQO-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.07 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [1,3]dioxolo[4,5-c]pyridin-6-ylmethanamine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1,3]dioxolo[4,5-c]pyridin-6-ylmethanamine;dihydrochloride?
The IUPAC name of [1,3]dioxolo[4,5-c]pyridin-6-ylmethanamine;dihydrochloride (CID 126824914) is [1,3]dioxolo[4,5-c]pyridin-6-ylmethanamine;dihydrochloride.
What is the SMILES notation for [1,3]dioxolo[4,5-c]pyridin-6-ylmethanamine;dihydrochloride?
The canonical SMILES for [1,3]dioxolo[4,5-c]pyridin-6-ylmethanamine;dihydrochloride is Cl.Cl.NCc1cc2c(cn1)OCO2.
What is the InChIKey of [1,3]dioxolo[4,5-c]pyridin-6-ylmethanamine;dihydrochloride?
The InChIKey is JKLUWXRLLBBYQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O2.2ClH/c8-2-5-1-6-7(3-9-5)11-4-10-6;;/h1,3H,2,4,8H2;2*1H.
What are the key properties of [1,3]dioxolo[4,5-c]pyridin-6-ylmethanamine;dihydrochloride?
[1,3]dioxolo[4,5-c]pyridin-6-ylmethanamine;dihydrochloride has a molecular weight of 225.07 g/mol, XLogP of 1.11, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1,3]dioxolo[4,5-c]pyridin-6-ylmethanamine;dihydrochloride is sourced from PubChem (CID 126824914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).