About 1-spiro[1,3-benzodioxole-2,3'-pyrrolidine]-1'-ylprop-2-en-1-one
1-spiro[1,3-benzodioxole-2,3'-pyrrolidine]-1'-ylprop-2-en-1-one (PubChem CID 126824922) has the molecular formula C13H13NO3
and a molecular weight of 231.25 g/mol. Its IUPAC name is 1-spiro[1,3-benzodioxole-2,3'-pyrrolidine]-1'-ylprop-2-en-1-one.
Molecular Properties
| Compound Name | 1-spiro[1,3-benzodioxole-2,3'-pyrrolidine]-1'-ylprop-2-en-1-one |
| PubChem CID | 126824922 |
| Molecular Formula | C13H13NO3 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | 1-spiro[1,3-benzodioxole-2,3'-pyrrolidine]-1'-ylprop-2-en-1-one |
| SMILES | C=CC(=O)N1CCC2(C1)Oc1ccccc1O2 |
| InChI | InChI=1S/C13H13NO3/c1-2-12(15)14-8-7-13(9-14)16-10-5-3-4-6-11(10)17-13/h2-6H,1,7-9H2 |
| InChIKey | VZNVABRPAHVUPL-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-spiro[1,3-benzodioxole-2,3'-pyrrolidine]-1'-ylprop-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-spiro[1,3-benzodioxole-2,3'-pyrrolidine]-1'-ylprop-2-en-1-one?
The IUPAC name of 1-spiro[1,3-benzodioxole-2,3'-pyrrolidine]-1'-ylprop-2-en-1-one (CID 126824922) is 1-spiro[1,3-benzodioxole-2,3'-pyrrolidine]-1'-ylprop-2-en-1-one.
What is the SMILES notation for 1-spiro[1,3-benzodioxole-2,3'-pyrrolidine]-1'-ylprop-2-en-1-one?
The canonical SMILES for 1-spiro[1,3-benzodioxole-2,3'-pyrrolidine]-1'-ylprop-2-en-1-one is C=CC(=O)N1CCC2(C1)Oc1ccccc1O2.
What is the InChIKey of 1-spiro[1,3-benzodioxole-2,3'-pyrrolidine]-1'-ylprop-2-en-1-one?
The InChIKey is VZNVABRPAHVUPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13NO3/c1-2-12(15)14-8-7-13(9-14)16-10-5-3-4-6-11(10)17-13/h2-6H,1,7-9H2.
What are the key properties of 1-spiro[1,3-benzodioxole-2,3'-pyrrolidine]-1'-ylprop-2-en-1-one?
1-spiro[1,3-benzodioxole-2,3'-pyrrolidine]-1'-ylprop-2-en-1-one has a molecular weight of 231.25 g/mol, XLogP of 1.57, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-spiro[1,3-benzodioxole-2,3'-pyrrolidine]-1'-ylprop-2-en-1-one is sourced from PubChem (CID 126824922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).