tert-butyl 2,2-dimethyl-3-(prop-2-enoylamino)propanoate

C12H21NO3 — CID 126824924

IUPACtert-butyl 2,2-dimethyl-3-(prop-2-enoylamino)propanoate
SMILESC=CC(=O)NCC(C)(C)C(=O)OC(C)(C)C
InChIInChI=1S/C12H21NO3/c1-7-9(14)13-8-12(5,6)10(15)16-11(2,3)4/h7H,1,8H2,2-6H3,(H,13,14)
InChIKeyGZLXEWIJJHEBFP-UHFFFAOYSA-N
MW227.30 g/mol
LogP1.66
Rot. Bonds4

About tert-butyl 2,2-dimethyl-3-(prop-2-enoylamino)propanoate

tert-butyl 2,2-dimethyl-3-(prop-2-enoylamino)propanoate (PubChem CID 126824924) has the molecular formula C12H21NO3 and a molecular weight of 227.30 g/mol. Its IUPAC name is tert-butyl 2,2-dimethyl-3-(prop-2-enoylamino)propanoate.

Molecular Properties

Compound Nametert-butyl 2,2-dimethyl-3-(prop-2-enoylamino)propanoate
PubChem CID126824924
Molecular FormulaC12H21NO3
Molecular Weight227.30 g/mol
Exact Mass227.15
IUPAC Nametert-butyl 2,2-dimethyl-3-(prop-2-enoylamino)propanoate
SMILESC=CC(=O)NCC(C)(C)C(=O)OC(C)(C)C
InChIInChI=1S/C12H21NO3/c1-7-9(14)13-8-12(5,6)10(15)16-11(2,3)4/h7H,1,8H2,2-6H3,(H,13,14)
InChIKeyGZLXEWIJJHEBFP-UHFFFAOYSA-N
XLogP1.66
TPSA55.40 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500227.30
LogP ≤ 51.66
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze tert-butyl 2,2-dimethyl-3-(prop-2-enoylamino)propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of tert-butyl 2,2-dimethyl-3-(prop-2-enoylamino)propanoate?
The IUPAC name of tert-butyl 2,2-dimethyl-3-(prop-2-enoylamino)propanoate (CID 126824924) is tert-butyl 2,2-dimethyl-3-(prop-2-enoylamino)propanoate.
What is the SMILES notation for tert-butyl 2,2-dimethyl-3-(prop-2-enoylamino)propanoate?
The canonical SMILES for tert-butyl 2,2-dimethyl-3-(prop-2-enoylamino)propanoate is C=CC(=O)NCC(C)(C)C(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl 2,2-dimethyl-3-(prop-2-enoylamino)propanoate?
The InChIKey is GZLXEWIJJHEBFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21NO3/c1-7-9(14)13-8-12(5,6)10(15)16-11(2,3)4/h7H,1,8H2,2-6H3,(H,13,14).
What are the key properties of tert-butyl 2,2-dimethyl-3-(prop-2-enoylamino)propanoate?
tert-butyl 2,2-dimethyl-3-(prop-2-enoylamino)propanoate has a molecular weight of 227.30 g/mol, XLogP of 1.66, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2,2-dimethyl-3-(prop-2-enoylamino)propanoate is sourced from PubChem (CID 126824924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).