C15H17N3O2S — CID 126825107
N-(4-cyclopropylpyrimidin-2-yl)-2-ethylbenzenesulfonamide (PubChem CID 126825107) has the molecular formula C15H17N3O2S and a molecular weight of 303.39 g/mol. Its IUPAC name is N-(4-cyclopropylpyrimidin-2-yl)-2-ethylbenzenesulfonamide.
| Compound Name | N-(4-cyclopropylpyrimidin-2-yl)-2-ethylbenzenesulfonamide |
|---|---|
| PubChem CID | 126825107 |
| Molecular Formula | C15H17N3O2S |
| Molecular Weight | 303.39 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | N-(4-cyclopropylpyrimidin-2-yl)-2-ethylbenzenesulfonamide |
| SMILES | CCc1ccccc1S(=O)(=O)Nc1nccc(C2CC2)n1 |
| InChI | InChI=1S/C15H17N3O2S/c1-2-11-5-3-4-6-14(11)21(19,20)18-15-16-10-9-13(17-15)12-7-8-12/h3-6,9-10,12H,2,7-8H2,1H3,(H,16,17,18) |
| InChIKey | NHBCMJKHKQPNDK-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.39 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |