About 2-ethyl-6-(5-methyl-3,5-dihydro-2H-1,4-benzoxazepin-4-yl)pyrimidine-4-carbonitrile
2-ethyl-6-(5-methyl-3,5-dihydro-2H-1,4-benzoxazepin-4-yl)pyrimidine-4-carbonitrile (PubChem CID 126825365) has the molecular formula C17H18N4O
and a molecular weight of 294.36 g/mol. Its IUPAC name is 2-ethyl-6-(5-methyl-3,5-dihydro-2H-1,4-benzoxazepin-4-yl)pyrimidine-4-carbonitrile.
Molecular Properties
| Compound Name | 2-ethyl-6-(5-methyl-3,5-dihydro-2H-1,4-benzoxazepin-4-yl)pyrimidine-4-carbonitrile |
| PubChem CID | 126825365 |
| Molecular Formula | C17H18N4O |
| Molecular Weight | 294.36 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | 2-ethyl-6-(5-methyl-3,5-dihydro-2H-1,4-benzoxazepin-4-yl)pyrimidine-4-carbonitrile |
| SMILES | CCc1nc(C#N)cc(N2CCOc3ccccc3C2C)n1 |
| InChI | InChI=1S/C17H18N4O/c1-3-16-19-13(11-18)10-17(20-16)21-8-9-22-15-7-5-4-6-14(15)12(21)2/h4-7,10,12H,3,8-9H2,1-2H3 |
| InChIKey | PWLSLGSXWVIVBE-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 62.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.36 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-ethyl-6-(5-methyl-3,5-dihydro-2H-1,4-benzoxazepin-4-yl)pyrimidine-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-6-(5-methyl-3,5-dihydro-2H-1,4-benzoxazepin-4-yl)pyrimidine-4-carbonitrile?
The IUPAC name of 2-ethyl-6-(5-methyl-3,5-dihydro-2H-1,4-benzoxazepin-4-yl)pyrimidine-4-carbonitrile (CID 126825365) is 2-ethyl-6-(5-methyl-3,5-dihydro-2H-1,4-benzoxazepin-4-yl)pyrimidine-4-carbonitrile.
What is the SMILES notation for 2-ethyl-6-(5-methyl-3,5-dihydro-2H-1,4-benzoxazepin-4-yl)pyrimidine-4-carbonitrile?
The canonical SMILES for 2-ethyl-6-(5-methyl-3,5-dihydro-2H-1,4-benzoxazepin-4-yl)pyrimidine-4-carbonitrile is CCc1nc(C#N)cc(N2CCOc3ccccc3C2C)n1.
What is the InChIKey of 2-ethyl-6-(5-methyl-3,5-dihydro-2H-1,4-benzoxazepin-4-yl)pyrimidine-4-carbonitrile?
The InChIKey is PWLSLGSXWVIVBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18N4O/c1-3-16-19-13(11-18)10-17(20-16)21-8-9-22-15-7-5-4-6-14(15)12(21)2/h4-7,10,12H,3,8-9H2,1-2H3.
What are the key properties of 2-ethyl-6-(5-methyl-3,5-dihydro-2H-1,4-benzoxazepin-4-yl)pyrimidine-4-carbonitrile?
2-ethyl-6-(5-methyl-3,5-dihydro-2H-1,4-benzoxazepin-4-yl)pyrimidine-4-carbonitrile has a molecular weight of 294.36 g/mol, XLogP of 2.87, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-6-(5-methyl-3,5-dihydro-2H-1,4-benzoxazepin-4-yl)pyrimidine-4-carbonitrile is sourced from PubChem (CID 126825365), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).