About 1-[1-(imidazo[1,2-a]pyrimidin-2-ylmethyl)triazol-4-yl]cyclohexan-1-ol
1-[1-(imidazo[1,2-a]pyrimidin-2-ylmethyl)triazol-4-yl]cyclohexan-1-ol (PubChem CID 126825656) has the molecular formula C15H18N6O
and a molecular weight of 298.35 g/mol. Its IUPAC name is 1-[1-(imidazo[1,2-a]pyrimidin-2-ylmethyl)triazol-4-yl]cyclohexan-1-ol.
Molecular Properties
| Compound Name | 1-[1-(imidazo[1,2-a]pyrimidin-2-ylmethyl)triazol-4-yl]cyclohexan-1-ol |
| PubChem CID | 126825656 |
| Molecular Formula | C15H18N6O |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | 1-[1-(imidazo[1,2-a]pyrimidin-2-ylmethyl)triazol-4-yl]cyclohexan-1-ol |
| SMILES | OC1(c2cn(Cc3cn4cccnc4n3)nn2)CCCCC1 |
| InChI | InChI=1S/C15H18N6O/c22-15(5-2-1-3-6-15)13-11-21(19-18-13)10-12-9-20-8-4-7-16-14(20)17-12/h4,7-9,11,22H,1-3,5-6,10H2 |
| InChIKey | CENMVSYPCCNLCN-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 81.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1-[1-(imidazo[1,2-a]pyrimidin-2-ylmethyl)triazol-4-yl]cyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-(imidazo[1,2-a]pyrimidin-2-ylmethyl)triazol-4-yl]cyclohexan-1-ol?
The IUPAC name of 1-[1-(imidazo[1,2-a]pyrimidin-2-ylmethyl)triazol-4-yl]cyclohexan-1-ol (CID 126825656) is 1-[1-(imidazo[1,2-a]pyrimidin-2-ylmethyl)triazol-4-yl]cyclohexan-1-ol.
What is the SMILES notation for 1-[1-(imidazo[1,2-a]pyrimidin-2-ylmethyl)triazol-4-yl]cyclohexan-1-ol?
The canonical SMILES for 1-[1-(imidazo[1,2-a]pyrimidin-2-ylmethyl)triazol-4-yl]cyclohexan-1-ol is OC1(c2cn(Cc3cn4cccnc4n3)nn2)CCCCC1.
What is the InChIKey of 1-[1-(imidazo[1,2-a]pyrimidin-2-ylmethyl)triazol-4-yl]cyclohexan-1-ol?
The InChIKey is CENMVSYPCCNLCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N6O/c22-15(5-2-1-3-6-15)13-11-21(19-18-13)10-12-9-20-8-4-7-16-14(20)17-12/h4,7-9,11,22H,1-3,5-6,10H2.
What are the key properties of 1-[1-(imidazo[1,2-a]pyrimidin-2-ylmethyl)triazol-4-yl]cyclohexan-1-ol?
1-[1-(imidazo[1,2-a]pyrimidin-2-ylmethyl)triazol-4-yl]cyclohexan-1-ol has a molecular weight of 298.35 g/mol, XLogP of 1.52, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-(imidazo[1,2-a]pyrimidin-2-ylmethyl)triazol-4-yl]cyclohexan-1-ol is sourced from PubChem (CID 126825656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).