C13H27N — CID 12682622
N-tert-butyl-2,2,4,4-tetramethylpentan-3-imine (PubChem CID 12682622) has the molecular formula C13H27N and a molecular weight of 197.37 g/mol. Its IUPAC name is N-tert-butyl-2,2,4,4-tetramethylpentan-3-imine.
| Compound Name | N-tert-butyl-2,2,4,4-tetramethylpentan-3-imine |
|---|---|
| PubChem CID | 12682622 |
| Molecular Formula | C13H27N |
| Molecular Weight | 197.37 g/mol |
| Exact Mass | 197.21 |
| IUPAC Name | N-tert-butyl-2,2,4,4-tetramethylpentan-3-imine |
| SMILES | CC(C)(C)N=C(C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C13H27N/c1-11(2,3)10(12(4,5)6)14-13(7,8)9/h1-9H3 |
| InChIKey | FRHUPASETRFWMG-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.37 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|