C13H18F3N3O2S — CID 126826310
5-methyl-N-[6-[(2,2,2-trifluoroacetyl)amino]hexyl]-1,2-thiazole-3-carboxamide (PubChem CID 126826310) has the molecular formula C13H18F3N3O2S and a molecular weight of 337.37 g/mol. Its IUPAC name is 5-methyl-N-[6-[(2,2,2-trifluoroacetyl)amino]hexyl]-1,2-thiazole-3-carboxamide.
| Compound Name | 5-methyl-N-[6-[(2,2,2-trifluoroacetyl)amino]hexyl]-1,2-thiazole-3-carboxamide |
|---|---|
| PubChem CID | 126826310 |
| Molecular Formula | C13H18F3N3O2S |
| Molecular Weight | 337.37 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | 5-methyl-N-[6-[(2,2,2-trifluoroacetyl)amino]hexyl]-1,2-thiazole-3-carboxamide |
| SMILES | Cc1cc(C(=O)NCCCCCCNC(=O)C(F)(F)F)ns1 |
| InChI | InChI=1S/C13H18F3N3O2S/c1-9-8-10(19-22-9)11(20)17-6-4-2-3-5-7-18-12(21)13(14,15)16/h8H,2-7H2,1H3,(H,17,20)(H,18,21) |
| InChIKey | UHLRWHHPZZJGAU-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.37 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|