About 2-[1-([1]benzofuro[3,2-d]pyrimidin-4-yl)piperidin-4-yl]-2-fluoroacetamide
2-[1-([1]benzofuro[3,2-d]pyrimidin-4-yl)piperidin-4-yl]-2-fluoroacetamide (PubChem CID 126826467) has the molecular formula C17H17FN4O2
and a molecular weight of 328.35 g/mol. Its IUPAC name is 2-[1-([1]benzofuro[3,2-d]pyrimidin-4-yl)piperidin-4-yl]-2-fluoroacetamide.
Molecular Properties
| Compound Name | 2-[1-([1]benzofuro[3,2-d]pyrimidin-4-yl)piperidin-4-yl]-2-fluoroacetamide |
| PubChem CID | 126826467 |
| Molecular Formula | C17H17FN4O2 |
| Molecular Weight | 328.35 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | 2-[1-([1]benzofuro[3,2-d]pyrimidin-4-yl)piperidin-4-yl]-2-fluoroacetamide |
| SMILES | NC(=O)C(F)C1CCN(c2ncnc3c2oc2ccccc23)CC1 |
| InChI | InChI=1S/C17H17FN4O2/c18-13(16(19)23)10-5-7-22(8-6-10)17-15-14(20-9-21-17)11-3-1-2-4-12(11)24-15/h1-4,9-10,13H,5-8H2,(H2,19,23) |
| InChIKey | BMCQZCRBIGFYCD-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.35 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[1-([1]benzofuro[3,2-d]pyrimidin-4-yl)piperidin-4-yl]-2-fluoroacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-([1]benzofuro[3,2-d]pyrimidin-4-yl)piperidin-4-yl]-2-fluoroacetamide?
The IUPAC name of 2-[1-([1]benzofuro[3,2-d]pyrimidin-4-yl)piperidin-4-yl]-2-fluoroacetamide (CID 126826467) is 2-[1-([1]benzofuro[3,2-d]pyrimidin-4-yl)piperidin-4-yl]-2-fluoroacetamide.
What is the SMILES notation for 2-[1-([1]benzofuro[3,2-d]pyrimidin-4-yl)piperidin-4-yl]-2-fluoroacetamide?
The canonical SMILES for 2-[1-([1]benzofuro[3,2-d]pyrimidin-4-yl)piperidin-4-yl]-2-fluoroacetamide is NC(=O)C(F)C1CCN(c2ncnc3c2oc2ccccc23)CC1.
What is the InChIKey of 2-[1-([1]benzofuro[3,2-d]pyrimidin-4-yl)piperidin-4-yl]-2-fluoroacetamide?
The InChIKey is BMCQZCRBIGFYCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17FN4O2/c18-13(16(19)23)10-5-7-22(8-6-10)17-15-14(20-9-21-17)11-3-1-2-4-12(11)24-15/h1-4,9-10,13H,5-8H2,(H2,19,23).
What are the key properties of 2-[1-([1]benzofuro[3,2-d]pyrimidin-4-yl)piperidin-4-yl]-2-fluoroacetamide?
2-[1-([1]benzofuro[3,2-d]pyrimidin-4-yl)piperidin-4-yl]-2-fluoroacetamide has a molecular weight of 328.35 g/mol, XLogP of 2.42, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-([1]benzofuro[3,2-d]pyrimidin-4-yl)piperidin-4-yl]-2-fluoroacetamide is sourced from PubChem (CID 126826467), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).