About 1-cyclohexyl-N-(4,4-dimethyl-2-oxopyrrolidin-3-yl)methanesulfonamide
1-cyclohexyl-N-(4,4-dimethyl-2-oxopyrrolidin-3-yl)methanesulfonamide (PubChem CID 126826580) has the molecular formula C13H24N2O3S
and a molecular weight of 288.41 g/mol. Its IUPAC name is 1-cyclohexyl-N-(4,4-dimethyl-2-oxopyrrolidin-3-yl)methanesulfonamide.
Molecular Properties
| Compound Name | 1-cyclohexyl-N-(4,4-dimethyl-2-oxopyrrolidin-3-yl)methanesulfonamide |
| PubChem CID | 126826580 |
| Molecular Formula | C13H24N2O3S |
| Molecular Weight | 288.41 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | 1-cyclohexyl-N-(4,4-dimethyl-2-oxopyrrolidin-3-yl)methanesulfonamide |
| SMILES | CC1(C)CNC(=O)C1NS(=O)(=O)CC1CCCCC1 |
| InChI | InChI=1S/C13H24N2O3S/c1-13(2)9-14-12(16)11(13)15-19(17,18)8-10-6-4-3-5-7-10/h10-11,15H,3-9H2,1-2H3,(H,14,16) |
| InChIKey | FOITWPUYJQEFHK-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.41 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-cyclohexyl-N-(4,4-dimethyl-2-oxopyrrolidin-3-yl)methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexyl-N-(4,4-dimethyl-2-oxopyrrolidin-3-yl)methanesulfonamide?
The IUPAC name of 1-cyclohexyl-N-(4,4-dimethyl-2-oxopyrrolidin-3-yl)methanesulfonamide (CID 126826580) is 1-cyclohexyl-N-(4,4-dimethyl-2-oxopyrrolidin-3-yl)methanesulfonamide.
What is the SMILES notation for 1-cyclohexyl-N-(4,4-dimethyl-2-oxopyrrolidin-3-yl)methanesulfonamide?
The canonical SMILES for 1-cyclohexyl-N-(4,4-dimethyl-2-oxopyrrolidin-3-yl)methanesulfonamide is CC1(C)CNC(=O)C1NS(=O)(=O)CC1CCCCC1.
What is the InChIKey of 1-cyclohexyl-N-(4,4-dimethyl-2-oxopyrrolidin-3-yl)methanesulfonamide?
The InChIKey is FOITWPUYJQEFHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24N2O3S/c1-13(2)9-14-12(16)11(13)15-19(17,18)8-10-6-4-3-5-7-10/h10-11,15H,3-9H2,1-2H3,(H,14,16).
What are the key properties of 1-cyclohexyl-N-(4,4-dimethyl-2-oxopyrrolidin-3-yl)methanesulfonamide?
1-cyclohexyl-N-(4,4-dimethyl-2-oxopyrrolidin-3-yl)methanesulfonamide has a molecular weight of 288.41 g/mol, XLogP of 1.01, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexyl-N-(4,4-dimethyl-2-oxopyrrolidin-3-yl)methanesulfonamide is sourced from PubChem (CID 126826580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).