C12H16FN3O — CID 126827123
[(1R,4S)-4-[(5-fluoro-2,6-dimethylpyrimidin-4-yl)amino]cyclopent-2-en-1-yl]methanol (PubChem CID 126827123) has the molecular formula C12H16FN3O and a molecular weight of 237.28 g/mol. Its IUPAC name is [(1R,4S)-4-[(5-fluoro-2,6-dimethylpyrimidin-4-yl)amino]cyclopent-2-en-1-yl]methanol.
| Compound Name | [(1R,4S)-4-[(5-fluoro-2,6-dimethylpyrimidin-4-yl)amino]cyclopent-2-en-1-yl]methanol |
|---|---|
| PubChem CID | 126827123 |
| Molecular Formula | C12H16FN3O |
| Molecular Weight | 237.28 g/mol |
| Exact Mass | 237.13 |
| IUPAC Name | [(1R,4S)-4-[(5-fluoro-2,6-dimethylpyrimidin-4-yl)amino]cyclopent-2-en-1-yl]methanol |
| SMILES | Cc1nc(C)c(F)c(N[C@@H]2C=C[C@H](CO)C2)n1 |
| InChI | InChI=1S/C12H16FN3O/c1-7-11(13)12(15-8(2)14-7)16-10-4-3-9(5-10)6-17/h3-4,9-10,17H,5-6H2,1-2H3,(H,14,15,16)/t9-,10+/m0/s1 |
| InChIKey | FPPBNCXQGXYORL-VHSXEESVSA-N |
| XLogP | 1.58 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.28 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|