C16H25N5OS — CID 126827491
2-[2-(diethylamino)ethylsulfanyl]-N-[(6-methyl-[1,2,4]triazolo[4,3-a]pyridin-3-yl)methyl]acetamide (PubChem CID 126827491) has the molecular formula C16H25N5OS and a molecular weight of 335.48 g/mol. Its IUPAC name is 2-[2-(diethylamino)ethylsulfanyl]-N-[(6-methyl-[1,2,4]triazolo[4,3-a]pyridin-3-yl)methyl]acetamide.
| Compound Name | 2-[2-(diethylamino)ethylsulfanyl]-N-[(6-methyl-[1,2,4]triazolo[4,3-a]pyridin-3-yl)methyl]acetamide |
|---|---|
| PubChem CID | 126827491 |
| Molecular Formula | C16H25N5OS |
| Molecular Weight | 335.48 g/mol |
| Exact Mass | 335.18 |
| IUPAC Name | 2-[2-(diethylamino)ethylsulfanyl]-N-[(6-methyl-[1,2,4]triazolo[4,3-a]pyridin-3-yl)methyl]acetamide |
| SMILES | CCN(CC)CCSCC(=O)NCc1nnc2ccc(C)cn12 |
| InChI | InChI=1S/C16H25N5OS/c1-4-20(5-2)8-9-23-12-16(22)17-10-15-19-18-14-7-6-13(3)11-21(14)15/h6-7,11H,4-5,8-10,12H2,1-3H3,(H,17,22) |
| InChIKey | SFYGODHXVCGFEI-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 62.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.48 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|