C16H20N2O3 — CID 126827942
2-oxo-N-(2,3,4,5-tetrahydro-1-benzoxepin-5-yl)piperidine-3-carboxamide (PubChem CID 126827942) has the molecular formula C16H20N2O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is 2-oxo-N-(2,3,4,5-tetrahydro-1-benzoxepin-5-yl)piperidine-3-carboxamide.
| Compound Name | 2-oxo-N-(2,3,4,5-tetrahydro-1-benzoxepin-5-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 126827942 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | 2-oxo-N-(2,3,4,5-tetrahydro-1-benzoxepin-5-yl)piperidine-3-carboxamide |
| SMILES | O=C1NCCCC1C(=O)NC1CCCOc2ccccc21 |
| InChI | InChI=1S/C16H20N2O3/c19-15-12(6-3-9-17-15)16(20)18-13-7-4-10-21-14-8-2-1-5-11(13)14/h1-2,5,8,12-13H,3-4,6-7,9-10H2,(H,17,19)(H,18,20) |
| InChIKey | WFBHNMOZEJGRNL-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|