About methyl 5-[[[1-(dimethylamino)-1-phenylpropan-2-yl]amino]methyl]-1,2-oxazole-3-carboxylate
methyl 5-[[[1-(dimethylamino)-1-phenylpropan-2-yl]amino]methyl]-1,2-oxazole-3-carboxylate (PubChem CID 126828235) has the molecular formula C17H23N3O3
and a molecular weight of 317.39 g/mol. Its IUPAC name is methyl 5-[[[1-(dimethylamino)-1-phenylpropan-2-yl]amino]methyl]-1,2-oxazole-3-carboxylate.
Molecular Properties
| Compound Name | methyl 5-[[[1-(dimethylamino)-1-phenylpropan-2-yl]amino]methyl]-1,2-oxazole-3-carboxylate |
| PubChem CID | 126828235 |
| Molecular Formula | C17H23N3O3 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | methyl 5-[[[1-(dimethylamino)-1-phenylpropan-2-yl]amino]methyl]-1,2-oxazole-3-carboxylate |
| SMILES | COC(=O)c1cc(CNC(C)C(c2ccccc2)N(C)C)on1 |
| InChI | InChI=1S/C17H23N3O3/c1-12(16(20(2)3)13-8-6-5-7-9-13)18-11-14-10-15(19-23-14)17(21)22-4/h5-10,12,16,18H,11H2,1-4H3 |
| InChIKey | NDHWZZMMZAMSEF-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 67.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 5-[[[1-(dimethylamino)-1-phenylpropan-2-yl]amino]methyl]-1,2-oxazole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-[[[1-(dimethylamino)-1-phenylpropan-2-yl]amino]methyl]-1,2-oxazole-3-carboxylate?
The IUPAC name of methyl 5-[[[1-(dimethylamino)-1-phenylpropan-2-yl]amino]methyl]-1,2-oxazole-3-carboxylate (CID 126828235) is methyl 5-[[[1-(dimethylamino)-1-phenylpropan-2-yl]amino]methyl]-1,2-oxazole-3-carboxylate.
What is the SMILES notation for methyl 5-[[[1-(dimethylamino)-1-phenylpropan-2-yl]amino]methyl]-1,2-oxazole-3-carboxylate?
The canonical SMILES for methyl 5-[[[1-(dimethylamino)-1-phenylpropan-2-yl]amino]methyl]-1,2-oxazole-3-carboxylate is COC(=O)c1cc(CNC(C)C(c2ccccc2)N(C)C)on1.
What is the InChIKey of methyl 5-[[[1-(dimethylamino)-1-phenylpropan-2-yl]amino]methyl]-1,2-oxazole-3-carboxylate?
The InChIKey is NDHWZZMMZAMSEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23N3O3/c1-12(16(20(2)3)13-8-6-5-7-9-13)18-11-14-10-15(19-23-14)17(21)22-4/h5-10,12,16,18H,11H2,1-4H3.
What are the key properties of methyl 5-[[[1-(dimethylamino)-1-phenylpropan-2-yl]amino]methyl]-1,2-oxazole-3-carboxylate?
methyl 5-[[[1-(dimethylamino)-1-phenylpropan-2-yl]amino]methyl]-1,2-oxazole-3-carboxylate has a molecular weight of 317.39 g/mol, XLogP of 2.24, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-[[[1-(dimethylamino)-1-phenylpropan-2-yl]amino]methyl]-1,2-oxazole-3-carboxylate is sourced from PubChem (CID 126828235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).