C12H12Cl2N2O2S — CID 126828702
4-[2-(3,4-dichlorophenyl)sulfonylethyl]-1-methylpyrazole (PubChem CID 126828702) has the molecular formula C12H12Cl2N2O2S and a molecular weight of 319.21 g/mol. Its IUPAC name is 4-[2-(3,4-dichlorophenyl)sulfonylethyl]-1-methylpyrazole.
| Compound Name | 4-[2-(3,4-dichlorophenyl)sulfonylethyl]-1-methylpyrazole |
|---|---|
| PubChem CID | 126828702 |
| Molecular Formula | C12H12Cl2N2O2S |
| Molecular Weight | 319.21 g/mol |
| Exact Mass | 318.00 |
| IUPAC Name | 4-[2-(3,4-dichlorophenyl)sulfonylethyl]-1-methylpyrazole |
| SMILES | Cn1cc(CCS(=O)(=O)c2ccc(Cl)c(Cl)c2)cn1 |
| InChI | InChI=1S/C12H12Cl2N2O2S/c1-16-8-9(7-15-16)4-5-19(17,18)10-2-3-11(13)12(14)6-10/h2-3,6-8H,4-5H2,1H3 |
| InChIKey | NMHLZPWTCLFKBE-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.21 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |