C16H27N3O3 — CID 126829065
1-(3,3,5-trimethylcyclohexanecarbonyl)pyrrolidine-3,4-dicarboxamide (PubChem CID 126829065) has the molecular formula C16H27N3O3 and a molecular weight of 309.41 g/mol. Its IUPAC name is 1-(3,3,5-trimethylcyclohexanecarbonyl)pyrrolidine-3,4-dicarboxamide.
| Compound Name | 1-(3,3,5-trimethylcyclohexanecarbonyl)pyrrolidine-3,4-dicarboxamide |
|---|---|
| PubChem CID | 126829065 |
| Molecular Formula | C16H27N3O3 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.21 |
| IUPAC Name | 1-(3,3,5-trimethylcyclohexanecarbonyl)pyrrolidine-3,4-dicarboxamide |
| SMILES | CC1CC(C(=O)N2CC(C(N)=O)C(C(N)=O)C2)CC(C)(C)C1 |
| InChI | InChI=1S/C16H27N3O3/c1-9-4-10(6-16(2,3)5-9)15(22)19-7-11(13(17)20)12(8-19)14(18)21/h9-12H,4-8H2,1-3H3,(H2,17,20)(H2,18,21) |
| InChIKey | BEHUHJSIGZPICJ-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 106.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |