C12H19N5S — CID 126829220
2-[4-(3-ethyl-1,2,4-thiadiazol-5-yl)-2,6-dimethylpiperazin-1-yl]acetonitrile (PubChem CID 126829220) has the molecular formula C12H19N5S and a molecular weight of 265.39 g/mol. Its IUPAC name is 2-[4-(3-ethyl-1,2,4-thiadiazol-5-yl)-2,6-dimethylpiperazin-1-yl]acetonitrile.
| Compound Name | 2-[4-(3-ethyl-1,2,4-thiadiazol-5-yl)-2,6-dimethylpiperazin-1-yl]acetonitrile |
|---|---|
| PubChem CID | 126829220 |
| Molecular Formula | C12H19N5S |
| Molecular Weight | 265.39 g/mol |
| Exact Mass | 265.14 |
| IUPAC Name | 2-[4-(3-ethyl-1,2,4-thiadiazol-5-yl)-2,6-dimethylpiperazin-1-yl]acetonitrile |
| SMILES | CCc1nsc(N2CC(C)N(CC#N)C(C)C2)n1 |
| InChI | InChI=1S/C12H19N5S/c1-4-11-14-12(18-15-11)16-7-9(2)17(6-5-13)10(3)8-16/h9-10H,4,6-8H2,1-3H3 |
| InChIKey | KSMJGQZCBRFYAP-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 56.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.39 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|