C17H20N2O2S — CID 126829290
N-[4-(hydroxymethyl)thian-4-yl]-2-isoquinolin-4-ylacetamide (PubChem CID 126829290) has the molecular formula C17H20N2O2S and a molecular weight of 316.43 g/mol. Its IUPAC name is N-[4-(hydroxymethyl)thian-4-yl]-2-isoquinolin-4-ylacetamide.
| Compound Name | N-[4-(hydroxymethyl)thian-4-yl]-2-isoquinolin-4-ylacetamide |
|---|---|
| PubChem CID | 126829290 |
| Molecular Formula | C17H20N2O2S |
| Molecular Weight | 316.43 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | N-[4-(hydroxymethyl)thian-4-yl]-2-isoquinolin-4-ylacetamide |
| SMILES | O=C(Cc1cncc2ccccc12)NC1(CO)CCSCC1 |
| InChI | InChI=1S/C17H20N2O2S/c20-12-17(5-7-22-8-6-17)19-16(21)9-14-11-18-10-13-3-1-2-4-15(13)14/h1-4,10-11,20H,5-9,12H2,(H,19,21) |
| InChIKey | HQNBJIQDYICUQB-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.43 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |