About 2-(chloromethyl)-4,6-dimethylpyrimidine
2-(chloromethyl)-4,6-dimethylpyrimidine (PubChem CID 12682962) has the molecular formula C7H9ClN2
and a molecular weight of 156.62 g/mol. Its IUPAC name is 2-(chloromethyl)-4,6-dimethylpyrimidine.
Molecular Properties
| Compound Name | 2-(chloromethyl)-4,6-dimethylpyrimidine |
| PubChem CID | 12682962 |
| Molecular Formula | C7H9ClN2 |
| Molecular Weight | 156.62 g/mol |
| Exact Mass | 156.05 |
| IUPAC Name | 2-(chloromethyl)-4,6-dimethylpyrimidine |
| SMILES | Cc1cc(C)nc(CCl)n1 |
| InChI | InChI=1S/C7H9ClN2/c1-5-3-6(2)10-7(4-8)9-5/h3H,4H2,1-2H3 |
| InChIKey | RVPRPXSYGUYDMT-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.62 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-(chloromethyl)-4,6-dimethylpyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(chloromethyl)-4,6-dimethylpyrimidine?
The IUPAC name of 2-(chloromethyl)-4,6-dimethylpyrimidine (CID 12682962) is 2-(chloromethyl)-4,6-dimethylpyrimidine.
What is the SMILES notation for 2-(chloromethyl)-4,6-dimethylpyrimidine?
The canonical SMILES for 2-(chloromethyl)-4,6-dimethylpyrimidine is Cc1cc(C)nc(CCl)n1.
What is the InChIKey of 2-(chloromethyl)-4,6-dimethylpyrimidine?
The InChIKey is RVPRPXSYGUYDMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9ClN2/c1-5-3-6(2)10-7(4-8)9-5/h3H,4H2,1-2H3.
What are the key properties of 2-(chloromethyl)-4,6-dimethylpyrimidine?
2-(chloromethyl)-4,6-dimethylpyrimidine has a molecular weight of 156.62 g/mol, XLogP of 1.83, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(chloromethyl)-4,6-dimethylpyrimidine is sourced from PubChem (CID 12682962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).