About tert-butyl N-[1-(5-fluoro-3,6-dihydro-2H-pyridin-1-yl)-4-methoxybutan-2-yl]carbamate
tert-butyl N-[1-(5-fluoro-3,6-dihydro-2H-pyridin-1-yl)-4-methoxybutan-2-yl]carbamate (PubChem CID 126829622) has the molecular formula C15H27FN2O3
and a molecular weight of 302.39 g/mol. Its IUPAC name is tert-butyl N-[1-(5-fluoro-3,6-dihydro-2H-pyridin-1-yl)-4-methoxybutan-2-yl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[1-(5-fluoro-3,6-dihydro-2H-pyridin-1-yl)-4-methoxybutan-2-yl]carbamate |
| PubChem CID | 126829622 |
| Molecular Formula | C15H27FN2O3 |
| Molecular Weight | 302.39 g/mol |
| Exact Mass | 302.20 |
| IUPAC Name | tert-butyl N-[1-(5-fluoro-3,6-dihydro-2H-pyridin-1-yl)-4-methoxybutan-2-yl]carbamate |
| SMILES | COCCC(CN1CCC=C(F)C1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H27FN2O3/c1-15(2,3)21-14(19)17-13(7-9-20-4)11-18-8-5-6-12(16)10-18/h6,13H,5,7-11H2,1-4H3,(H,17,19) |
| InChIKey | JEZTYQAUQGXMCL-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.39 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tert-butyl N-[1-(5-fluoro-3,6-dihydro-2H-pyridin-1-yl)-4-methoxybutan-2-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[1-(5-fluoro-3,6-dihydro-2H-pyridin-1-yl)-4-methoxybutan-2-yl]carbamate?
The IUPAC name of tert-butyl N-[1-(5-fluoro-3,6-dihydro-2H-pyridin-1-yl)-4-methoxybutan-2-yl]carbamate (CID 126829622) is tert-butyl N-[1-(5-fluoro-3,6-dihydro-2H-pyridin-1-yl)-4-methoxybutan-2-yl]carbamate.
What is the SMILES notation for tert-butyl N-[1-(5-fluoro-3,6-dihydro-2H-pyridin-1-yl)-4-methoxybutan-2-yl]carbamate?
The canonical SMILES for tert-butyl N-[1-(5-fluoro-3,6-dihydro-2H-pyridin-1-yl)-4-methoxybutan-2-yl]carbamate is COCCC(CN1CCC=C(F)C1)NC(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl N-[1-(5-fluoro-3,6-dihydro-2H-pyridin-1-yl)-4-methoxybutan-2-yl]carbamate?
The InChIKey is JEZTYQAUQGXMCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H27FN2O3/c1-15(2,3)21-14(19)17-13(7-9-20-4)11-18-8-5-6-12(16)10-18/h6,13H,5,7-11H2,1-4H3,(H,17,19).
What are the key properties of tert-butyl N-[1-(5-fluoro-3,6-dihydro-2H-pyridin-1-yl)-4-methoxybutan-2-yl]carbamate?
tert-butyl N-[1-(5-fluoro-3,6-dihydro-2H-pyridin-1-yl)-4-methoxybutan-2-yl]carbamate has a molecular weight of 302.39 g/mol, XLogP of 2.48, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[1-(5-fluoro-3,6-dihydro-2H-pyridin-1-yl)-4-methoxybutan-2-yl]carbamate is sourced from PubChem (CID 126829622), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).