About (2R)-1-[(3-bromothieno[2,3-c]pyridin-7-yl)amino]-3-methoxypropan-2-ol
(2R)-1-[(3-bromothieno[2,3-c]pyridin-7-yl)amino]-3-methoxypropan-2-ol (PubChem CID 126829718) has the molecular formula C11H13BrN2O2S
and a molecular weight of 317.21 g/mol. Its IUPAC name is (2R)-1-[(3-bromothieno[2,3-c]pyridin-7-yl)amino]-3-methoxypropan-2-ol.
Molecular Properties
| Compound Name | (2R)-1-[(3-bromothieno[2,3-c]pyridin-7-yl)amino]-3-methoxypropan-2-ol |
| PubChem CID | 126829718 |
| Molecular Formula | C11H13BrN2O2S |
| Molecular Weight | 317.21 g/mol |
| Exact Mass | 315.99 |
| IUPAC Name | (2R)-1-[(3-bromothieno[2,3-c]pyridin-7-yl)amino]-3-methoxypropan-2-ol |
| SMILES | COC[C@H](O)CNc1nccc2c(Br)csc12 |
| InChI | InChI=1S/C11H13BrN2O2S/c1-16-5-7(15)4-14-11-10-8(2-3-13-11)9(12)6-17-10/h2-3,6-7,15H,4-5H2,1H3,(H,13,14)/t7-/m1/s1 |
| InChIKey | IBVDBVPQLMUOBR-SSDOTTSWSA-N |
| XLogP | 2.48 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.21 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2R)-1-[(3-bromothieno[2,3-c]pyridin-7-yl)amino]-3-methoxypropan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-1-[(3-bromothieno[2,3-c]pyridin-7-yl)amino]-3-methoxypropan-2-ol?
The IUPAC name of (2R)-1-[(3-bromothieno[2,3-c]pyridin-7-yl)amino]-3-methoxypropan-2-ol (CID 126829718) is (2R)-1-[(3-bromothieno[2,3-c]pyridin-7-yl)amino]-3-methoxypropan-2-ol.
What is the SMILES notation for (2R)-1-[(3-bromothieno[2,3-c]pyridin-7-yl)amino]-3-methoxypropan-2-ol?
The canonical SMILES for (2R)-1-[(3-bromothieno[2,3-c]pyridin-7-yl)amino]-3-methoxypropan-2-ol is COC[C@H](O)CNc1nccc2c(Br)csc12.
What is the InChIKey of (2R)-1-[(3-bromothieno[2,3-c]pyridin-7-yl)amino]-3-methoxypropan-2-ol?
The InChIKey is IBVDBVPQLMUOBR-SSDOTTSWSA-N. The full InChI is InChI=1S/C11H13BrN2O2S/c1-16-5-7(15)4-14-11-10-8(2-3-13-11)9(12)6-17-10/h2-3,6-7,15H,4-5H2,1H3,(H,13,14)/t7-/m1/s1.
What are the key properties of (2R)-1-[(3-bromothieno[2,3-c]pyridin-7-yl)amino]-3-methoxypropan-2-ol?
(2R)-1-[(3-bromothieno[2,3-c]pyridin-7-yl)amino]-3-methoxypropan-2-ol has a molecular weight of 317.21 g/mol, XLogP of 2.48, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-1-[(3-bromothieno[2,3-c]pyridin-7-yl)amino]-3-methoxypropan-2-ol is sourced from PubChem (CID 126829718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).