About 2-[[2-[methyl(methylsulfonyl)amino]acetyl]amino]-1,3-thiazole-5-sulfonyl fluoride
2-[[2-[methyl(methylsulfonyl)amino]acetyl]amino]-1,3-thiazole-5-sulfonyl fluoride (PubChem CID 126829959) has the molecular formula C7H10FN3O5S3
and a molecular weight of 331.37 g/mol. Its IUPAC name is 2-[[2-[methyl(methylsulfonyl)amino]acetyl]amino]-1,3-thiazole-5-sulfonyl fluoride.
Molecular Properties
| Compound Name | 2-[[2-[methyl(methylsulfonyl)amino]acetyl]amino]-1,3-thiazole-5-sulfonyl fluoride |
| PubChem CID | 126829959 |
| Molecular Formula | C7H10FN3O5S3 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 330.98 |
| IUPAC Name | 2-[[2-[methyl(methylsulfonyl)amino]acetyl]amino]-1,3-thiazole-5-sulfonyl fluoride |
| SMILES | CN(CC(=O)Nc1ncc(S(=O)(=O)F)s1)S(C)(=O)=O |
| InChI | InChI=1S/C7H10FN3O5S3/c1-11(18(2,13)14)4-5(12)10-7-9-3-6(17-7)19(8,15)16/h3H,4H2,1-2H3,(H,9,10,12) |
| InChIKey | HSJSOAYHBJOKIY-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 113.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-[[2-[methyl(methylsulfonyl)amino]acetyl]amino]-1,3-thiazole-5-sulfonyl fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[2-[methyl(methylsulfonyl)amino]acetyl]amino]-1,3-thiazole-5-sulfonyl fluoride?
The IUPAC name of 2-[[2-[methyl(methylsulfonyl)amino]acetyl]amino]-1,3-thiazole-5-sulfonyl fluoride (CID 126829959) is 2-[[2-[methyl(methylsulfonyl)amino]acetyl]amino]-1,3-thiazole-5-sulfonyl fluoride.
What is the SMILES notation for 2-[[2-[methyl(methylsulfonyl)amino]acetyl]amino]-1,3-thiazole-5-sulfonyl fluoride?
The canonical SMILES for 2-[[2-[methyl(methylsulfonyl)amino]acetyl]amino]-1,3-thiazole-5-sulfonyl fluoride is CN(CC(=O)Nc1ncc(S(=O)(=O)F)s1)S(C)(=O)=O.
What is the InChIKey of 2-[[2-[methyl(methylsulfonyl)amino]acetyl]amino]-1,3-thiazole-5-sulfonyl fluoride?
The InChIKey is HSJSOAYHBJOKIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10FN3O5S3/c1-11(18(2,13)14)4-5(12)10-7-9-3-6(17-7)19(8,15)16/h3H,4H2,1-2H3,(H,9,10,12).
What are the key properties of 2-[[2-[methyl(methylsulfonyl)amino]acetyl]amino]-1,3-thiazole-5-sulfonyl fluoride?
2-[[2-[methyl(methylsulfonyl)amino]acetyl]amino]-1,3-thiazole-5-sulfonyl fluoride has a molecular weight of 331.37 g/mol, XLogP of -0.37, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[2-[methyl(methylsulfonyl)amino]acetyl]amino]-1,3-thiazole-5-sulfonyl fluoride is sourced from PubChem (CID 126829959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).