C10H14N2O3S — CID 126829996
2-(oxolan-2-ylmethoxy)-N-(1,2-thiazol-5-yl)acetamide (PubChem CID 126829996) has the molecular formula C10H14N2O3S and a molecular weight of 242.30 g/mol. Its IUPAC name is 2-(oxolan-2-ylmethoxy)-N-(1,2-thiazol-5-yl)acetamide.
| Compound Name | 2-(oxolan-2-ylmethoxy)-N-(1,2-thiazol-5-yl)acetamide |
|---|---|
| PubChem CID | 126829996 |
| Molecular Formula | C10H14N2O3S |
| Molecular Weight | 242.30 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | 2-(oxolan-2-ylmethoxy)-N-(1,2-thiazol-5-yl)acetamide |
| SMILES | O=C(COCC1CCCO1)Nc1ccns1 |
| InChI | InChI=1S/C10H14N2O3S/c13-9(12-10-3-4-11-16-10)7-14-6-8-2-1-5-15-8/h3-4,8H,1-2,5-7H2,(H,12,13) |
| InChIKey | CDSHEHLGZPZQGX-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.30 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |