C11H13FN4S2 — CID 126830138
5-[1-(6-fluoro-3-pyridinyl)ethylsulfanyl]-N,N-dimethyl-1,3,4-thiadiazol-2-amine (PubChem CID 126830138) has the molecular formula C11H13FN4S2 and a molecular weight of 284.39 g/mol. Its IUPAC name is 5-[1-(6-fluoro-3-pyridinyl)ethylsulfanyl]-N,N-dimethyl-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-[1-(6-fluoro-3-pyridinyl)ethylsulfanyl]-N,N-dimethyl-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 126830138 |
| Molecular Formula | C11H13FN4S2 |
| Molecular Weight | 284.39 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | 5-[1-(6-fluoro-3-pyridinyl)ethylsulfanyl]-N,N-dimethyl-1,3,4-thiadiazol-2-amine |
| SMILES | CC(Sc1nnc(N(C)C)s1)c1ccc(F)nc1 |
| InChI | InChI=1S/C11H13FN4S2/c1-7(8-4-5-9(12)13-6-8)17-11-15-14-10(18-11)16(2)3/h4-7H,1-3H3 |
| InChIKey | RRQDCSXEJJWGFX-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.39 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|