C18H25N5O — CID 126830172
N,N-diethyl-4-(3-pyridin-4-yl-1H-pyrazol-5-yl)piperidine-1-carboxamide (PubChem CID 126830172) has the molecular formula C18H25N5O and a molecular weight of 327.43 g/mol. Its IUPAC name is N,N-diethyl-4-(3-pyridin-4-yl-1H-pyrazol-5-yl)piperidine-1-carboxamide.
| Compound Name | N,N-diethyl-4-(3-pyridin-4-yl-1H-pyrazol-5-yl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 126830172 |
| Molecular Formula | C18H25N5O |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.21 |
| IUPAC Name | N,N-diethyl-4-(3-pyridin-4-yl-1H-pyrazol-5-yl)piperidine-1-carboxamide |
| SMILES | CCN(CC)C(=O)N1CCC(c2cc(-c3ccncc3)n[nH]2)CC1 |
| InChI | InChI=1S/C18H25N5O/c1-3-22(4-2)18(24)23-11-7-15(8-12-23)17-13-16(20-21-17)14-5-9-19-10-6-14/h5-6,9-10,13,15H,3-4,7-8,11-12H2,1-2H3,(H,20,21) |
| InChIKey | PUIRGLUJUSEZML-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |