C17H26N2O5 — CID 126830361
ethyl 3-hydroxy-2-[(2-pentoxyacetyl)amino]-3-pyridin-4-ylpropanoate (PubChem CID 126830361) has the molecular formula C17H26N2O5 and a molecular weight of 338.40 g/mol. Its IUPAC name is ethyl 3-hydroxy-2-[(2-pentoxyacetyl)amino]-3-pyridin-4-ylpropanoate.
| Compound Name | ethyl 3-hydroxy-2-[(2-pentoxyacetyl)amino]-3-pyridin-4-ylpropanoate |
|---|---|
| PubChem CID | 126830361 |
| Molecular Formula | C17H26N2O5 |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.18 |
| IUPAC Name | ethyl 3-hydroxy-2-[(2-pentoxyacetyl)amino]-3-pyridin-4-ylpropanoate |
| SMILES | CCCCCOCC(=O)NC(C(=O)OCC)C(O)c1ccncc1 |
| InChI | InChI=1S/C17H26N2O5/c1-3-5-6-11-23-12-14(20)19-15(17(22)24-4-2)16(21)13-7-9-18-10-8-13/h7-10,15-16,21H,3-6,11-12H2,1-2H3,(H,19,20) |
| InChIKey | AOGQZCAQRWWBSH-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 97.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.40 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|